1.0 2010-04-08 22:05:09 UTC 2025-11-18 22:33:27 UTC FDB001892 1-Dehydro-[6]-gingerdione 1-dehydro-[6]-gingerdione belongs to hydroxycinnamic acids and derivatives class of compounds. Those are compounds containing an cinnamic acid (or a derivative thereof) where the benzene ring is hydroxylated. 1-dehydro-[6]-gingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 1-dehydro-[6]-gingerdione can be found in ginger, which makes 1-dehydro-[6]-gingerdione a potential biomarker for the consumption of this food product. 1-(4-Hydroxy-3-methoxy-phenyl)-undec-1-en-3-one C17H22O4 290.3542 290.151809192 (1E,4Z)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,4-dien-3-one (1E,4Z)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,4-dien-3-one 748159-33-3 CCCCC\C(O)=C\C(=O)\C=C\C1=CC(OC)=C(O)C=C1 InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-12,18,20H,3-6H2,1-2H3/b9-7+,14-12- GPNSDXAINXYRNZ-YYKRUEADSA-N belongs to the class of organic compounds known as hydroxycinnamic acids and derivatives. Hydroxycinnamic acids and derivatives are compounds containing an cinnamic acid (or a derivative thereof) where the benzene ring is hydroxylated. Hydroxycinnamic acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acryloyl compounds Alkyl aryl ethers Anisoles Enols Enones Hydrocarbon derivatives Ketones Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Styrenes Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid Acryloyl-group Alkyl aryl ether Alpha,beta-unsaturated ketone Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Enol Enone Ether Hydrocarbon derivative Hydroxycinnamic acid or derivatives Ketone Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Styrene Vinylogous acid hydroxycinnamic acid logp 3.83 ALOGPS logs -3.83 ALOGPS solubility 4.28e-02 g/l ALOGPS logp 4.1 ChemAxon pka_strongest_acidic 8.19 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac (1E,4Z)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,4-dien-3-one ChemAxon average_mass 290.3542 ChemAxon mono_mass 290.151809192 ChemAxon smiles CCCCC\C(O)=C\C(=O)\C=C\C1=CC(OC)=C(O)C=C1 ChemAxon formula C17H22O4 ChemAxon inchi InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-12,18,20H,3-6H2,1-2H3/b9-7+,14-12- ChemAxon inchikey GPNSDXAINXYRNZ-YYKRUEADSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 85.83 ChemAxon polarizability 33.18 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 98475 Specdb::MsMs 98476 Specdb::MsMs 98477 Specdb::MsMs 163401 Specdb::MsMs 163402 Specdb::MsMs 163403 Specdb::MsMs 3599005 Specdb::MsMs 3599006 Specdb::MsMs 3599007 Specdb::MsMs 3599008 Specdb::MsMs 3599009 Specdb::MsMs 3599010 Ginger Type 1 specific Zingiber officinale 94328