1.0 2010-04-08 22:07:54 UTC 2025-11-18 23:06:18 UTC FDB008051 Heptanoic acid Present in essential oils, e.g. violet leaf oil, palm oiland is also present in apple, feijoa fruit, strawberry jam, clove bud, ginger, black tea, morello cherry, grapes, rice bran and other foodstuffs. Flavouring ingredient. It is used as one of the components in washing solns. used to assist lye peeling of fruit and vegetables Heptanoic acid, also called enanthic acid, is an organic compound composed of a seven-carbon chain terminating in a carboxylic acid. It is an oily liquid with an unpleasant, rancid odor. It contributes to the odor of some rancid oils. It is slightly soluble in water, but very soluble in ethanol and ether.; Heptanoic acid, also called enanthic acid, is an organic compound composed of a seven-carbon chain terminating in a carboxylic acid. It is an oily liquid with an unpleasant, rancid odor. It contributes to the odor of some rancid oils. It is slightly soluble in water, but well soluble in ethanol and ether.; It is also one of many additives in cigarettes. Heptanoic acid is found in many foods, some of which are soup, sauce, scallop, and leek. 1-heptanoic acid 1-Hexanecarboxylate 1-Hexanecarboxylic acid 1-Hexanecarboxylic acid ate Bacterio-chlorophylls CH3-[CH2]5-COOH Enanthate Enanthic acid Enanthic anhydride Enanthylate Enanthylic acid FEMA 3348 Heptanoate Heptanoic acid (enantic acid) Heptansaeure Hepthlic acid Heptoate Heptoic acid Heptylate Heptylic acid Hexacid C-7 Hexane-1-carboxylic acid N-heptanoate N-heptanoic acid N-heptoate N-heptoic acid N-heptylate N-heptylic acid Oenanthate Oenanthic acid Oenanthsaeure Oenanthylate Oenanthylic acid SHV C7H14O2 130.1849 130.099379692 heptanoic acid heptanoic acid 111-14-8 CCCCCCC(O)=O InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) MNWFXJYAOYHMED-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Straight chain fatty acids Straight chain fatty acids medium-chain fatty acid straight-chain saturated fatty acid Liquid logp 2.41 ALOGPS logs -1.64 ALOGPS solubility 2.98e+00 g/l ALOGPS melting_point Mp -9° logp 2.26 ChemAxon pka_strongest_acidic 5.15 ChemAxon iupac heptanoic acid ChemAxon average_mass 130.1849 ChemAxon mono_mass 130.099379692 ChemAxon smiles CCCCCCC(O)=O ChemAxon formula C7H14O2 ChemAxon inchi InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) ChemAxon inchikey MNWFXJYAOYHMED-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 35.67 ChemAxon polarizability 15.33 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1235 Specdb::CMs 944 Specdb::CMs 2398 Specdb::CMs 29465 Specdb::CMs 31187 Specdb::CMs 37683 Specdb::CMs 137169 Specdb::CMs 144903 Specdb::CMs 1072276 Specdb::MsIr 718 Specdb::MsIr 719 Specdb::MsIr 720 Specdb::MsMs 6247 Specdb::MsMs 6248 Specdb::MsMs 6249 Specdb::MsMs 6250 Specdb::MsMs 6251 Specdb::MsMs 178071 Specdb::MsMs 178072 Specdb::MsMs 178073 Specdb::MsMs 180384 Specdb::MsMs 180385 Specdb::MsMs 180386 Specdb::MsMs 437836 Specdb::MsMs 437837 Specdb::MsMs 437838 Specdb::MsMs 437839 Specdb::MsMs 438659 Specdb::MsMs 2284183 Specdb::MsMs 2284184 Specdb::MsMs 2284185 Specdb::MsMs 3081741 Specdb::MsMs 3081742 Specdb::MsMs 3081743 Specdb::NmrOneD 1464 Specdb::NmrOneD 2832 Specdb::NmrOneD 7302 Specdb::NmrOneD 7303 Specdb::NmrOneD 7304 Specdb::NmrOneD 7305 Specdb::NmrOneD 7306 Specdb::NmrOneD 7307 Specdb::NmrOneD 7308 Specdb::NmrOneD 7309 Specdb::NmrOneD 7310 Specdb::NmrOneD 7311 Specdb::NmrOneD 7312 Specdb::NmrOneD 7313 Specdb::NmrOneD 7314 Specdb::NmrOneD 7315 Specdb::NmrOneD 7316 Specdb::NmrOneD 7317 Specdb::NmrOneD 7318 Specdb::NmrOneD 7319 Specdb::NmrOneD 7320 Specdb::NmrOneD 7321 Specdb::NmrTwoD 1409 HMDB00666 45571 SHV #<Reference:0x000055ce327a7848> #<Reference:0x000055ce327a7640> #<Reference:0x000055ce327a7438> Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 1.0 1.0 1.0 mg/100 g Alcoholic beverages Unknown generic Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.125 1.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 6.333333 14.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 4.5 5.0 4.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.714286 5.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 2.75 24.0 0.0 mg/100 g Arepa Type 2 specific 28.0 28.0 28.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 15.0 15.0 15.0 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 43.0 43.0 43.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 7.5625 50.0 0.0 mg/100 g Bagel Type 2 specific 1.666667 5.0 0.0 mg/100 g Baked beans Type 2 specific 1.333333 3.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bean Type 1 specific 1.333333 3.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 128.5 157.0 100.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 10.0 27.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 15.047619 93.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 8.0 8.0 8.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 10.0 10.0 10.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 23.5 47.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.87931 8.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 52.933333 92.0 30.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 2.0 2.0 2.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burrito Type 2 specific 28.111111 75.0 0.0 mg/100 g Butter Type 2 specific 280.0 560.0 0.0 mg/100 g Buttermilk Type 2 specific 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 38.8 62.0 23.0 mg/100 g Candy bar Type 2 specific 30.692308 66.0 0.0 mg/100 g Canola Type 2 specific 138011 45.25 76.0 0.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 40.4 54.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 9.0 18.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 127.241206 410.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.2 1.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 9.5 10.0 9.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 18.767123 190.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 2.5 5.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 63.0 63.0 63.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chili Type 2 specific 50.333333 75.0 37.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 136.0 136.0 136.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 40.0 60.0 20.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 37.888889 100.0 0.0 mg/100 g Chocolate mousse Type 2 specific 4.0 4.0 4.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 60.0 110.0 10.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 210.0 210.0 210.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 16.0 17.0 15.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 44.0 44.0 44.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.0 0.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 1.0 4.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.333333 2.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 2.75 24.0 0.0 mg/100 g Coffee substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 12.0 12.0 12.0 mg/100 g Cold cut Type 2 specific 30.0 30.0 30.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common bean Type 1 specific Phaseolus vulgaris 3885 1.055556 7.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 1.0 2.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.666667 2.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Cooking oil Type 2 specific 36.0 133.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 2.689655 67.0 0.0 mg/100 g Corn chip Type 2 specific 0.0 0.0 0.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 6.0 6.0 6.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 11.0 11.0 11.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 27.666667 49.0 17.0 mg/100 g Cracker Type 2 specific 9.888889 26.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 9.6 96.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 12.888889 38.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.5 1.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 55.0 96.0 25.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 23.468852 274.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 52.0 52.0 52.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 36.0 47.0 24.0 mg/100 g Edible shell Type 2 specific 20.0 21.0 19.0 mg/100 g Egg roll Type 2 specific 8.5 16.0 4.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 12.0 57.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Empanada Type 2 specific 67.0 67.0 67.0 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 2.333333 4.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 27.8 57.0 0.0 mg/100 g Flour Type 2 specific 5.0 10.0 0.0 mg/100 g Focaccia Type 2 specific 1.0 1.0 1.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 17.0 36.0 0.0 mg/100 g French toast Type 2 specific 12.0 12.0 12.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 0.0 0.0 0.0 mg/100 g Fruits Unknown generic Frybread Type 2 specific 81.0 101.0 61.0 mg/100 g Fudge Type 2 specific 37.285714 68.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 1.0 1.0 1.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.4 2.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.666667 2.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.4 1.0 0.0 mg/100 g Hamburger Type 2 specific 121.869565 163.0 89.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 3.25 4.0 2.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 8.0 8.0 8.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 3.625 10.0 0.0 mg/100 g Hummus Type 2 specific 1.0 1.0 1.0 mg/100 g Hushpuppy Type 2 specific 14.0 14.0 14.0 mg/100 g Ice cream Type 2 specific 19.238095 47.0 0.0 mg/100 g Ice cream cone Type 2 specific 14.0 14.0 14.0 mg/100 g Icing Type 2 specific 30.0 91.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 1.666667 5.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 2.0 2.0 2.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 28.25 38.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 20.25 42.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 7.0 7.0 7.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 1.333333 4.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 145.333333 156.0 124.0 mg/100 g Macaroni and cheese Type 2 specific 13.0 35.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 4.0 4.0 4.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.033333 0.1 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 42.875 107.0 0.0 mg/100 g Margarine-like spread Type 2 specific 52.0 101.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 8.0 24.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 1.6 8.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 34.5 59.0 10.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 1.718818 11.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk and milk products Unknown generic Milkshake Type 2 specific 31.0 53.0 22.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.666667 2.0 0.0 mg/100 g Miso Type 2 specific 5.5 11.0 0.0 mg/100 g Mixed nuts Type 2 specific 46.0 46.0 46.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mule deer Type 1 specific Odocoileus 9871 Multigrain bread Type 2 specific 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 35.0 45.0 25.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 15.0 15.0 15.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 3.0 3.0 3.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 5.5 22.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread Type 2 specific 4.611111 28.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 33.636364 115.0 0.0 mg/100 g Other dish Type 2 specific 16.04 71.0 0.0 mg/100 g Other fermented milk Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 0.333333 1.0 0.0 mg/100 g Other frozen dessert Type 2 specific 10.0 17.0 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other pasta dish Type 2 specific 25.4 62.0 0.0 mg/100 g Other sandwich Type 2 specific 12.0 25.0 0.0 mg/100 g Other snack food Type 2 specific 5.125 23.0 0.0 mg/100 g Other soy product Type 2 specific 27.666667 50.0 3.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 1.0 1.0 1.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 4.5 5.0 4.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 3.5 4.0 3.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 12.0 12.0 12.0 mg/100 g Pancake Type 2 specific 2.6 4.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 2.75 30.0 0.0 mg/100 g Pastry Type 2 specific 11.057143 99.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 24.5 57.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 1.538462 14.0 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pie Type 2 specific 0.0 0.0 0.0 mg/100 g Pie crust Type 2 specific 68.125 109.0 28.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 4.0 5.0 3.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 13.2 16.0 10.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 4.0 10.0 0.0 mg/100 g Pizza Type 2 specific 50.140351 107.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 8.0 34.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 45.0 60.0 30.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 9.7 179.0 0.0 mg/100 g Potato bread Type 2 specific 0.0 0.0 0.0 mg/100 g Potato chip Type 2 specific 14.75 28.0 0.0 mg/100 g Potato puffs Type 2 specific 6.0 6.0 6.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 99.0 161.0 29.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 1.454545 10.0 0.0 mg/100 g Pupusa Type 2 specific 40.0 68.0 21.0 mg/100 g Quail Type 1 specific Phasianidae 9005 Quesadilla Type 2 specific 56.0 56.0 56.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 31.0 31.0 31.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 11.0 16.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 28.0 44.0 12.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 1.25 5.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 2.75 24.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 94.0 94.0 94.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 14.0 24.0 7.0 mg/100 g Salad dressing Type 2 specific 10.192308 74.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 6.461538 50.0 0.0 mg/100 g Sausage Type 2 specific 77.769231 486.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 6.0 8.0 4.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 102.25 114.0 95.0 mg/100 g Shrimp Type 1 specific Caridea 6694 14.916667 26.0 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 190.0 190.0 190.0 mg/100 g Snack bar Type 2 specific 4.666667 18.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 17.4 70.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 3.0 3.0 3.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 7.241379 35.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 49.1875 124.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Squab Type 1 specific Columba 8931 Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 41.857143 66.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 2.5 5.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 84.5 169.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 28.25 38.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 15.875 37.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet custard Type 2 specific 4.0 10.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 37.5 41.0 34.0 mg/100 g Syrup Type 2 specific 6.666667 20.0 0.0 mg/100 g Taco Type 2 specific 57.625 91.0 19.0 mg/100 g Taco shell Type 2 19.0 19.0 19.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 29.25 59.0 8.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 185.666667 542.0 0.0 mg/100 g Topping Type 2 specific 19.0 19.0 19.0 mg/100 g Tortilla Type 2 specific 2.2 5.0 0.0 mg/100 g Tortilla chip Type 2 specific 16.2 22.0 9.0 mg/100 g Tostada shell Type 2 21.0 21.0 21.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 17.0 17.0 17.0 mg/100 g True sole Type 1 specific Soleidae 30948 7.0 7.0 7.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 5.0 8.0 2.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 8.833333 13.0 5.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 1.0 7.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 8.3 28.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 1.0 2.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 32.666667 80.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 2.5 5.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.666667 2.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 4.5 5.0 4.0 mg/100 g Ymer Type 2 specific 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Zwieback Type 2 specific 5.0 5.0 5.0 mg/100 g cheese cheesy rancid sour sweat