| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation date | 2010-04-08 22:08:19 UTC |
|---|
| Update date | 2020-09-17 15:38:19 UTC |
|---|
| Primary ID | FDB008937 |
|---|
| Secondary Accession Numbers | Not Available |
|---|
| Chemical Information |
|---|
| FooDB Name | 4-Aminobutyric acid |
|---|
| Description | gamma-Aminobutyric acid, also known as GABA or g-amino-butanoate, belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom. gamma-Aminobutyric acid is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. gamma-Aminobutyric acid exists in all living species, ranging from bacteria to humans. Outside of the human body, gamma-Aminobutyric acid has been detected, but not quantified in, several different foods, such as fox grapes, oxheart cabbages, garden onion (var.), yellow zucchinis, and chinese mustards. This could make gamma-aminobutyric acid a potential biomarker for the consumption of these foods. gamma-Aminobutyric acid is a potentially toxic compound. A gamma-amino acid that is butanoic acid with the amino substituent located at C-4. |
|---|
| CAS Number | 56-12-2 |
|---|
| Structure | |
|---|
| Synonyms | | Synonym | Source |
|---|
| 4-Aminobutanoic acid | ChEBI | | 4-Aminobutyric acid | ChEBI | | 4Abu | ChEBI | | GABA | ChEBI | | GAMMA-AMINO-butanoIC ACID | ChEBI | | gamma-Amino-N-butyric acid | ChEBI | | gamma-Aminobutanoic acid | ChEBI | | gamma-Aminobuttersaeure | ChEBI | | Omega-aminobutyric acid | ChEBI | | Piperidic acid | ChEBI | | Piperidinic acid | ChEBI | | 4-Aminobutyrate | Kegg | | Gammalon | Kegg | | 4-Aminobutanoate | Generator | | g-AMINO-butanoate | Generator | | g-AMINO-butanoic acid | Generator | | gamma-AMINO-butanoate | Generator | | Γ-amino-butanoate | Generator | | Γ-amino-butanoic acid | Generator | | g-Amino-N-butyrate | Generator | | g-Amino-N-butyric acid | Generator | | gamma-Amino-N-butyrate | Generator | | Γ-amino-N-butyrate | Generator | | Γ-amino-N-butyric acid | Generator | | g-Aminobutanoate | Generator | | g-Aminobutanoic acid | Generator | | gamma-Aminobutanoate | Generator | | Γ-aminobutanoate | Generator | | Γ-aminobutanoic acid | Generator | | g-Aminobuttersaeure | Generator | | Γ-aminobuttersaeure | Generator | | Omega-aminobutyrate | Generator | | Piperidate | Generator | | Piperidinate | Generator | | g-Aminobutyrate | Generator | | g-Aminobutyric acid | Generator | | gamma-Aminobutyrate | Generator | | Γ-aminobutyrate | Generator | | Γ-aminobutyric acid | Generator | | 3-Carboxypropylamine | HMDB | | Aminalon | HMDB | | Gaballon | HMDB | | Gamarex | HMDB | | gamma Aminobutyrate | HMDB | | gamma Aminobutyric acid | HMDB | | Gammalone | HMDB | | Gammar | HMDB | | Gammasol | HMDB | | Mielogen | HMDB | | Mielomade | HMDB | | W-Aminobutyrate | HMDB | | W-Aminobutyric acid | HMDB | | gamma-Aminobutyric acid, calcium salt (2:1) | HMDB | | gamma-Aminobutyric acid, hydrochloride | HMDB | | gamma-Aminobutyric acid, zinc salt (2:1) | HMDB | | 4 Aminobutanoic acid | HMDB | | 4 Aminobutyric acid | HMDB | | Lithium gaba | HMDB | | gamma Aminobutyric acid, monolithium salt | HMDB | | gamma Aminobutyric acid, monosodium salt | HMDB | | gamma-Aminobutyric acid, monolithium salt | HMDB | | gamma-Aminobutyric acid, monosodium salt | HMDB | | Acid, hydrochloride gamma-aminobutyric | HMDB | | Aminalone | HMDB | | GABA, lithium | HMDB | | Hydrochloride gamma-aminobutyric acid | HMDB | | gamma Aminobutyric acid, hydrochloride | HMDB | | 4-Amino-butanoate | HMDB | | gamma-Aminobutyric acid | KEGG | | 4-amino-butanoic acid | biospider | | 4-Amino-n-butyric acid | biospider | | 4-Aminobutylate | biospider | | Aminobutanoic acid | biospider | | Aminobutyric acid | biospider | | Aminobutyric acid,-4-, α | biospider | | Butanoic acid, 4-amino- (9CI) | biospider | | Butyric acid, 4-amino- | biospider | | DL-gamma-amino-n-butyric acid | biospider | | g-amino-BUTANOate | Generator | | g-amino-BUTANOic acid | Generator | | g-amino-N-Butyrate | Generator | | g-amino-N-Butyric acid | Generator | | g-aminobutyric acid | biospider | | Gamastan | biospider | | Gamma aminobutyrate | biospider | | Gamma aminobutyric acid | biospider | | Gamma-amino butyric acid | biospider | | gamma-amino-BUTANOate | Generator | | Gamma-amino-butanoic acid | biospider | | gamma-amino-N-Butyrate | Generator | | Gamma-amino-n-butyric acid | biospider | | Gamma-aminobutanoic acid | biospider | | Gamma-aminobutryic acid | biospider | | Gamma-aminobutyrate | biospider | | Gamma-aminobutyric acid | biospider | | Gamma(amino)-butyric acid | biospider | | Gammagee | biospider | | Gammalon (TN) | biospider | | Gamulin | biospider | | Reanal | biospider | | γ-amino-butanoate | Generator | | γ-amino-butanoic acid | Generator | | γ-amino-N-butyrate | Generator | | γ-amino-N-butyric acid | Generator | | γ-aminobutanoate | Generator | | γ-aminobutanoic acid | Generator | | γ-aminobuttersaeure | Generator | | γ-aminobutyrate | Generator | | γ-aminobutyric acid | Generator |
|
|---|
| Predicted Properties | |
|---|
| Chemical Formula | C4H9NO2 |
|---|
| IUPAC name | 4-aminobutanoic acid |
|---|
| InChI Identifier | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
|---|
| InChI Key | BTCSSZJGUNDROE-UHFFFAOYSA-N |
|---|
| Isomeric SMILES | NCCCC(O)=O |
|---|
| Average Molecular Weight | 103.1198 |
|---|
| Monoisotopic Molecular Weight | 103.063328537 |
|---|
| Classification |
|---|
| Description | Belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Gamma amino acids and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Gamma amino acid or derivatives
- Amino fatty acid
- Straight chain fatty acid
- Fatty acid
- Fatty acyl
- Amino acid
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Organic oxide
- Organopnictogen compound
- Primary amine
- Organooxygen compound
- Organonitrogen compound
- Primary aliphatic amine
- Organic oxygen compound
- Carbonyl group
- Organic nitrogen compound
- Amine
- Hydrocarbon derivative
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Ontology | No ontology term |
|---|
| Physico-Chemical Properties |
|---|
| Physico-Chemical Properties - Experimental | | Property | Value | Reference |
|---|
| Physical state | Solid | |
|---|
| Physical Description | Not Available | |
|---|
| Mass Composition | Not Available | |
|---|
| Melting Point | 203 oC | |
|---|
| Boiling Point | Not Available | |
|---|
| Experimental Water Solubility | 1300 mg/mL at 25 oC | YALKOWSKY,SH & DANNENFELSER,RM (1992) |
|---|
| Experimental logP | -3.17 | HANSCH,C ET AL. (1995) |
|---|
| Experimental pKa | 4.05 | |
|---|
| Isoelectric point | Not Available | |
|---|
| Charge | Not Available | |
|---|
| Optical Rotation | Not Available | |
|---|
| Spectroscopic UV Data | Not Available | |
|---|
| Density | Not Available | |
|---|
| Refractive Index | Not Available | |
|---|
|
|---|
| Spectra |
|---|
| Spectra | |
|---|
| EI-MS/GC-MS | | Type | Description | Splash Key | View |
|---|
| EI-MS | Mass Spectrum (Electron Ionization) | splash10-001i-9000000000-dbf4f9e19a35f953a189 | 2014-09-20 | View Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00dj-1900000000-f831f79dfcaeffa8b177 | Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00di-1900000000-2de9d92a2cfc7bc655f4 | Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00di-1900000000-73bbf2ee0803f058dbed | Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00di-1901000000-85d4bd98af8534428b5a | Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00di-0900000000-6be23968e972a414be51 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-1900000000-9a224763afd8ca892add | Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00di-9800000000-d8906d09ca1872a6391c | Spectrum | | GC-MS | 4-Aminobutyric acid, 2 TMS, GC-MS Spectrum | splash10-0udi-1900000000-54db7e21790401045519 | Spectrum | | GC-MS | 4-Aminobutyric acid, 3 TMS, GC-MS Spectrum | splash10-00di-1901000000-b047af158215c2b5b8e8 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-001i-9000000000-21ea76dfb0da62031f1d | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-0901000000-5d60b0a446fd8122f613 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00dj-1900000000-f831f79dfcaeffa8b177 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-1900000000-2de9d92a2cfc7bc655f4 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-1900000000-73bbf2ee0803f058dbed | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-1901000000-85d4bd98af8534428b5a | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-0900000000-6be23968e972a414be51 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-1900000000-9a224763afd8ca892add | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-9800000000-d8906d09ca1872a6391c | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-0udi-1900000000-54db7e21790401045519 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00di-1901000000-b047af158215c2b5b8e8 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-00dj-1900000000-1219470a0be188da64e6 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-0udi-0900000000-f7117dfaf9d856c95919 | Spectrum | | GC-MS | 4-Aminobutyric acid, non-derivatized, GC-MS Spectrum | splash10-0006-1900000000-e35585a985d8128d044e | Spectrum | | Predicted GC-MS | 4-Aminobutyric acid, non-derivatized, Predicted GC-MS Spectrum - 70eV, Positive | splash10-001i-9000000000-d5f55a414ff1e8c65d9d | Spectrum | | Predicted GC-MS | 4-Aminobutyric acid, 1 TMS, Predicted GC-MS Spectrum - 70eV, Positive | splash10-0fk9-9700000000-4b2809309587240dd479 | Spectrum |
|
|---|
| MS/MS | | Type | Description | Splash Key | View |
|---|
| MS/MS | LC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated) | splash10-0uxr-8900000000-ce0d8f44422836cd9965 | 2012-07-24 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated) | splash10-0005-9000000000-8ce5afb97d7c08821da3 | 2012-07-24 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated) | splash10-0005-9100000000-32c433b2c916697690f8 | 2012-07-24 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-0udi-0900000000-5831aaabdf53f3132ae5 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-0a4i-9000000000-9babfd4a6937ecba7318 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-0a4i-9000000000-e1c0c1485d846e9b123b | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-0udi-0900000000-647d55ecf98850e7a875 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-0udi-0900000000-7c107641a38922c88fca | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-000i-9000000000-86718b349efad6334e3a | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-000i-9000000000-a1e84e55e4b6c6628d5d | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientfic) , Positive | splash10-0006-0009000000-29c22bf0ed844d09c0af | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 10V, Negative | splash10-0udi-0900000000-1d00adad47e42c60c340 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 20V, Negative | splash10-0udi-1900000000-47b195fb74720cc99464 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 30V, Negative | splash10-001i-9000000000-a14a52dc59bf9988bb44 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 10V, Positive | splash10-0udi-5900000000-20c55b2809389d5ad83b | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 20V, Positive | splash10-000i-9000000000-eca4c5aefca98751a11e | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 30V, Positive | splash10-014j-9000000000-f0783316e09291749409 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 40V, Positive | splash10-0005-9000000000-81837eb9c0b926cb0e81 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QQ (API3000, Applied Biosystems) 50V, Positive | splash10-0005-9000000000-8b48126992d7fa242636 | 2012-08-31 | View Spectrum | | MS/MS | LC-MS/MS Spectrum - LC-ESI-QTOF (UPLC Q-Tof Premier, Waters) , Positive | splash10-000i-9000000000-7d4636efbc4e5d75872e | 2012-08-31 | View Spectrum | | Predicted MS/MS | Predicted LC-MS/MS Spectrum - 10V, Positive | splash10-000i-9100000000-655f9d93a35bfa537583 | 2015-05-27 | View Spectrum | | Predicted MS/MS | Predicted LC-MS/MS Spectrum - 20V, Positive | splash10-00ku-9000000000-4a334d5e272576f62403 | 2015-05-27 | View Spectrum | | Predicted MS/MS | Predicted LC-MS/MS Spectrum - 40V, Positive | splash10-0006-9000000000-4a13b03446b3370ccd43 | 2015-05-27 | View Spectrum | | Predicted MS/MS | Predicted LC-MS/MS Spectrum - 10V, Positive | splash10-000i-9100000000-655f9d93a35bfa537583 | 2015-05-27 | View Spectrum | | Predicted MS/MS | Predicted LC-MS/MS Spectrum - 20V, Positive | splash10-00ku-9000000000-4a334d5e272576f62403 | 2015-05-27 | View Spectrum |
|
|---|
| NMR | | Type | Description | | View |
|---|
| 1D NMR | 1H NMR Spectrum (1D, 600 MHz, H2O, experimental) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 125 MHz, H2O, experimental) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 90 MHz, D2O, experimental) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 25.16 MHz, D2O, experimental) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, D2O, experimental) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 100 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 100 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 200 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 200 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 300 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 300 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 400 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 400 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 500 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 500 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 600 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 600 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 700 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 700 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 800 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 800 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 900 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 900 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, D2O, predicted) | | Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 1000 MHz, D2O, predicted) | | Spectrum | | 2D NMR | [1H, 13C]-HSQC NMR Spectrum (2D, 600 MHz, H2O, experimental) | | Spectrum |
|
|---|
| External Links |
|---|
| ChemSpider ID | 116 |
|---|
| ChEMBL ID | CHEMBL96 |
|---|
| KEGG Compound ID | C00334 |
|---|
| Pubchem Compound ID | 119 |
|---|
| Pubchem Substance ID | Not Available |
|---|
| ChEBI ID | 16865 |
|---|
| Phenol-Explorer ID | Not Available |
|---|
| DrugBank ID | DB02530 |
|---|
| HMDB ID | HMDB00112 |
|---|
| CRC / DFC (Dictionary of Food Compounds) ID | Not Available |
|---|
| EAFUS ID | 165 |
|---|
| Dr. Duke ID | GABA|GAMMA-AMINOBUTYRIC-ACID |
|---|
| BIGG ID | 34652 |
|---|
| KNApSAcK ID | C00001337 |
|---|
| HET ID | ABU |
|---|
| Food Biomarker Ontology | Not Available |
|---|
| VMH ID | Not Available |
|---|
| Flavornet ID | Not Available |
|---|
| GoodScent ID | rw1198861 |
|---|
| SuperScent ID | Not Available |
|---|
| Wikipedia ID | GABA |
|---|
| Phenol-Explorer Metabolite ID | Not Available |
|---|
| Duplicate IDS | Not Available |
|---|
| Old DFC IDS | Not Available |
|---|
| Associated Foods |
|---|
| Food | Content Range | Average | Reference |
|---|
| Food | | | Reference |
|---|
|
| Biological Effects and Interactions |
|---|
| Health Effects / Bioactivities | | Descriptor | ID | Definition | Reference |
|---|
| Analeptic | 35337 | A central nervous system stimulant that increases alertness and counteracts depression, used therapeutically to treat conditions such as respiratory depression, sedative overdose, and coma, by enhancing brain activity and promoting arousal. | DUKE | | Anti cephalagic | 52217 | An agent that relieves headache symptoms, commonly used in managing migraines and other cephalalgias. Its biological role involves inhibiting pain pathways, and its therapeutic applications include reducing inflammation and alleviating vascular headaches, making it a key medical use in neurology and pain management. | DUKE | | Anti-cerebrotic | 52217 | An agent that prevents or reduces cerebral edema, promoting brain health. It has therapeutic applications in managing conditions like stroke, traumatic brain injury, and cerebral malaria, reducing swelling and inflammation to improve patient outcomes. | DUKE | | Anti-choreic | 52217 | An agent that reduces involuntary movements, commonly used in managing neurological disorders such as Huntington's disease, Parkinson's disease, and tic disorders, by blocking excessive dopamine activity in the brain, thereby alleviating symptoms of chorea, athetosis, and dystonia. | DUKE | | Anti convulsant | 52217 | An agent that reduces or prevents seizures, commonly used in managing epilepsy, neuropathic pain, and mood disorders, by stabilizing abnormal electrical activity in the brain. | DUKE | | Anti hypertensive | 52217 | An agent that lowers blood pressure, reducing the risk of cardiovascular disease. It plays a biological role in relaxing blood vessels, decreasing cardiac workload, and improving blood flow. Therapeutically, it's used to manage hypertension, heart failure, and stroke, with key medical applications in preventing organ damage and improving overall cardiovascular health. | DUKE | | Anti-insomniac | 52217 | An agent that promotes sleep, reducing insomnia symptoms. It regulates the body's sleep-wake cycle, commonly used in managing sleep disorders, such as chronic insomnia, and improving overall sleep quality. | DUKE | | Anti-insomnic | 52217 | An agent that promotes sleep, reducing insomnia symptoms. It regulates the body's sleep-wake cycle, commonly used in managing sleep disorders, such as insomnia, and improving sleep quality. | DUKE | | Anti-lethargic | 52217 | An agent that increases alertness and energy, counteracting lethargy. It plays a biological role in stimulating the central nervous system, and has therapeutic applications in treating fatigue, sleep disorders, and attention deficit hyperactivity disorder (ADHD). Key medical uses include managing excessive daytime sleepiness and improving cognitive function. | DUKE | | Anti-stress | 52217 | An agent that reduces stress symptoms, commonly used in managing anxiety disorders, promoting relaxation, and mitigating the biological effects of stress on the body, such as hypertension and immune suppression, with therapeutic applications in mental health and key medical uses in cardiology and neurology. | DUKE | | Anti tinnitic | | An agent that relieves symptoms of tinnitus, reducing constant noise or ringing in the ears, used to manage related hearing disorders and improve quality of life. | DUKE | | Anxiolytic | 35474 | An agent that reduces anxiety symptoms, commonly used in managing anxiety disorders, such as generalized anxiety disorder and panic disorder, by modulating neurotransmitters like GABA, promoting relaxation and calming effects. | DUKE | | Cardiovascular | 38070 | A system that transports blood, oxygen, and nutrients throughout the body, playing a crucial role in overall health. Therapeutically, cardiovascular agents manage conditions like hypertension, heart failure, and atherosclerosis, with key medical uses including regulating blood pressure, preventing blood clots, and improving cardiac function. | DUKE | | Central nervous system inhibitor | 35470 | An agent that suppresses or slows down central nervous system activity, reducing anxiety, stress, and excitability. Therapeutically, it is used to manage conditions such as insomnia, seizures, and anxiety disorders, promoting relaxation and calmness. | DUKE | | Diuretic | 35498 | An agent that increases urine production, helping remove excess fluids and salts from the body. It plays a key biological role in regulating fluid balance and blood pressure. Therapeutically, diuretics are used to treat conditions such as hypertension, edema, and heart failure, helping reduce swelling and lower blood pressure. | DUKE | | Hypotensive | | An agent that lowers blood pressure, playing a biological role in regulating cardiovascular function. Therapeutically, it's used to manage hypertension, heart failure, and angina, with key medical applications in preventing stroke, kidney disease, and cardiac complications. | DUKE | | Neuro inhibitor | 35222 | An agent that blocks or reduces neuronal activity, used to treat conditions such as epilepsy, anxiety, and muscle spasms by decreasing abnormal electrical impulses in the brain and nervous system. | DUKE | | Neurotoxic | 50910 | A substance that damages or destroys nerve cells, disrupting normal brain function. It has no therapeutic applications, but is used in research to study neurodegenerative diseases. Key medical uses include understanding and developing treatments for conditions like Alzheimer's and Parkinson's diseases, where neurotoxicity plays a role. | DUKE | | Neurotransmitter | 25512 | A chemical messenger that transmits signals between neurons, regulating various physiological and psychological processes. Therapeutically, neurotransmitter modulators are used to treat conditions such as depression, anxiety, and Parkinson's disease, by altering neurotransmitter levels or activity to restore balance and alleviate symptoms. | DUKE | | Sedative | 35717 | An agent that calms nervous activity, reducing anxiety and inducing relaxation. Its biological role is to slow down brain function, promoting sleep and relieving stress. Therapeutically, sedatives are used to manage insomnia, anxiety disorders, and seizures, as well as to prepare patients for medical procedures. | DUKE | | Tranquilizer | | An agent that induces relaxation and reduces anxiety, used therapeutically to manage anxiety disorders, insomnia, and restlessness, promoting calmness and sedation in individuals. | DUKE |
|
|---|
| Enzymes | | Name | Gene Name | UniProt ID |
|---|
| Glycine amidinotransferase, mitochondrial | GATM | P50440 | | 4-aminobutyrate aminotransferase, mitochondrial | ABAT | P80404 | | Glutamate decarboxylase 2 | GAD2 | Q05329 | | Glutamate decarboxylase 1 | GAD1 | Q99259 | | Arginine decarboxylase | ADC | Q96A70 | | Glutamine synthetase | GLUL | P15104 | | Probable glutamate--tRNA ligase, mitochondrial | EARS2 | Q5JPH6 | | Gamma-aminobutyric acid receptor-associated protein-like 2 | GABARAPL2 | P60520 |
|
|---|
| Pathways | |
|---|
| Metabolism | Not Available |
|---|
| Biosynthesis | Not Available |
|---|
| Organoleptic Properties |
|---|
| Flavours | | Flavor | Citations |
|---|
| savory |
- The Good Scents Company (2009). Flavor and fragrance information catalog. <http://www.thegoodscentscompany.com/allprod.html> Accessed 15.10.23.
| | meaty |
- The Good Scents Company (2009). Flavor and fragrance information catalog. <http://www.thegoodscentscompany.com/allprod.html> Accessed 15.10.23.
|
|
|---|
| Files |
|---|
| MSDS | Not Available |
|---|
| References |
|---|
| Synthesis Reference | Not Available |
|---|
| General Reference | Not Available |
|---|
| Content Reference | — Duke, James. 'Dr. Duke's Phytochemical and Ethnobotanical Databases. United States Department of Agriculture.' Agricultural Research Service, Accessed April 27 (2004).
|
|---|