1.0 2010-04-08 22:10:24 UTC 2019-11-26 03:07:45 UTC FDB012858 Oleic acid Major constituent of plant oils e.g. olive oil (ca. 80%), almond oil (ca. 80%) and many others, mainly as glyceride. Constituent of tall oiland is also present in apple, melon, raspberry oil, tomato, banana, roasted peanuts, black tea, rice bran, cardamon, plum brandy, peated malt, dairy products and various animal fats. Component of citrus fruit coatings. Emulsifying agent in foods Oleic acid is a monounsaturated omega-9 fatty acid found in various animal and vegetable fats. The trans isomer of oleic acid is called elaidic acid. (9Z)-9-Octadecenoate (9Z)-9-Octadecenoic acid (9Z)-Octadecenoate (9Z)-Octadecenoic acid (Z)-9-Octadecanoate (Z)-9-Octadecanoic acid (Z)-Octadec-9-enoate (Z)-Octadec-9-enoic acid 18:1 N-9 18:1Delta9cis 18:1δ9cis 9-(Z)-octadecenoate 9-(Z)-octadecenoic acid 9-Octadecenoic acid (Z)- 9-Octadecenoic acid, (Z)- 9-Octadecenoic acid, cis- 9,10-Octadecenoate 9,10-Octadecenoic acid C18:1 N-9 Century cd fatty acid cis-9-Octadecenoate cis-9-Octadecenoic acid cis-delta(9)-Octadecenoate cis-Delta(9)-Octadecenoic acid cis-Octadec-9-enoate cis-Octadec-9-enoic acid Cis-oleate Cis-oleic acid cis-δ(9)-octadecenoate cis-δ(9)-octadecenoic acid Distoline Emersol 210 Emersol 211 Emersol 213 Emersol 220 white oleate Emersol 220 white oleic acid Emersol 221 low titer white oleate Emersol 221 low titer white oleic acid Emersol 233ll Emersol 6321 Emersol 6333 NF Emersol 7021 FEMA 2815 Glycon ro Glycon WO Groco 2 Groco 4 Groco 5L Groco 6 Industrene 104 Industrene 105 Industrene 205 Industrene 206 L'acide oleique Metaupon MYX 6121 Octadec-9-enoate Octadec-9-enoic acid Oelsaeure Oelsauere Oleate Oleic acid extra pure Oleinate Oleinic acid Pamolyn Pamolyn 100 Pamolyn 100 fg Pamolyn 100 fgk Pamolyn 125 Priolene 6900 Rapinic acid Red oil Tego-oleic 130 Vopcolene 27 Wecoline OO Z-9-Octadecenoate Z-9-Octadecenoic acid C18H34O2 282.4614 282.255880332 (9Z)-octadec-9-enoic acid oleic acid 112-80-1 CCCCCCCC\C=C\CCCCCCCC(O)=O InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ ZQPPMHVWECSIRJ-MDZDMXLPSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Monounsaturated fatty acids Unsaturated fatty acids Unsaturated fatty acids octadec-9-enoic acid Liquid logp 7.68 ALOGPS logs -6.37 ALOGPS solubility 1.21e-04 g/l ALOGPS melting_point Mp 16° (stable form) logp 6.78 ChemAxon pka_strongest_acidic 4.99 ChemAxon iupac (9Z)-octadec-9-enoic acid ChemAxon average_mass 282.4614 ChemAxon mono_mass 282.255880332 ChemAxon smiles CCCCCCCC\C=C\CCCCCCCC(O)=O ChemAxon formula C18H34O2 ChemAxon inchi InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ ChemAxon inchikey ZQPPMHVWECSIRJ-MDZDMXLPSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 87.4 ChemAxon polarizability 37.09 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1978 Specdb::NmrOneD 1190 Specdb::NmrTwoD 1206 Specdb::CMs 463 Specdb::CMs 1874 Specdb::CMs 2563 Specdb::CMs 27397 Specdb::CMs 30911 Specdb::CMs 31072 Specdb::CMs 37356 Specdb::CMs 153882 Specdb::CMs 1054040 Specdb::MsMs 334 Specdb::MsMs 335 Specdb::MsMs 336 Specdb::MsMs 797 Specdb::MsMs 798 Specdb::MsMs 799 Specdb::MsMs 3612 Specdb::MsMs 3613 Specdb::MsMs 178443 Specdb::MsMs 178444 Specdb::MsMs 178445 Specdb::MsMs 180762 Specdb::MsMs 180763 Specdb::MsMs 180764 Specdb::MsMs 285572 Specdb::MsMs 285573 Specdb::MsMs 285574 Specdb::MsMs 285575 Specdb::MsMs 373995 Specdb::MsMs 373996 Specdb::MsMs 373997 Specdb::MsMs 373998 Specdb::MsMs 373999 Specdb::MsMs 438646 Specdb::MsMs 440469 HMDB00207 OLA #<Reference:0x000055ce321a7038> #<Reference:0x000055ce321a6e58> #<Reference:0x000055ce321a6c78> #<Reference:0x000055ce321a6a70> #<Reference:0x000055ce321a6890> #<Reference:0x000055ce321a66b0> #<Reference:0x000055ce321a64a8> #<Reference:0x000055ce321a62c8> #<Reference:0x000055ce321a60e8> #<Reference:0x000055ce321a5ee0> #<Reference:0x000055ce321a5d00> #<Reference:0x000055ce321a5b20> #<Reference:0x000055ce321a5918> #<Reference:0x000055ce321a56e8> #<Reference:0x000055ce321a5508> #<Reference:0x000055ce321a5260> #<Reference:0x000055ce321a50a8> #<Reference:0x000055ce321a4ec8> #<Reference:0x000055ce321a4c48> #<Reference:0x000055ce321a4a90> #<Reference:0x000055ce321a48b0> Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Alcoholic beverages Unknown generic Alfalfa Type 1 specific Medicago sativa 3879 28.0 56.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 16.0 28.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 30370.675 34041.35 26700.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 5472.857143 16700.0 650.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 2070.0 2070.0 2070.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 7770.0 7850.0 7690.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 21700.0 21700.0 21700.0 mg/100 g Apple Type 1 specific Malus pumila 283210 18.591667 50.55 6.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 6758.55 32960.0 22.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 135.857143 936.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 11.54 41.7 2.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 317.0 317.0 317.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 469.0 469.0 469.0 mg/100 g Avocado Type 1 specific Persea americana 3435 23616.25 35932.5 11300.0 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 418.0 795.0 204.0 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 4438.333333 7070.0 0.0 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 3947.8 3947.8 3947.8 mg/100 g Black elderberry Type 1 specific Sambucus nigra 4202 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 11600.0 11600.0 11600.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 Blackcurrant Type 1 specific Ribes nigrum 78511 1767.585714 12000.0 25.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Borage Type 1 specific Borago officinalis 13363 20000.0 20000.0 20000.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 24902.5 30305.0 19500.0 mg/100 g Breakfast cereal Type 2 specific 529.5 1890.0 0.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 53.25 53.25 53.25 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 11.333333 33.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 26.87 77.35 14.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 3300.0 3300.0 3300.0 mg/100 g Butter Type 2 specific 19450.0 20200.0 18700.0 mg/100 g Buttermilk Type 2 specific 111.0 111.0 111.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 10530.85 10530.85 10530.85 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 93.4 93.4 93.4 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 4475.0 8876.25 73.75 mg/100 g Capers Type 1 specific Capparis spinosa 65558 7518.975 14916.0 121.95 mg/100 g Caraway Type 1 specific Carum carvi 48032 Cardamom Type 1 specific Elettaria cardamomum 105181 5227.1 5227.1 5227.1 mg/100 g Carob Type 1 specific Ceratonia siliqua 20340 Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 1795.4375 14305.0 2.0 mg/100 g Casein Type 2 specific 320.0 320.0 320.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 27301.333333 28204.0 26800.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 145.5 217.0 74.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 853.0 853.0 853.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 4271.638298 11900.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 18.8 26.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 13.0 13.0 13.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 13.0 13.0 13.0 mg/100 g Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 5118.216667 9790.0 89.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 5437.5 10875.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 884.0 884.0 884.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 3084.071429 6420.0 687.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 716.875 1433.75 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 10.6 21.4 4.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 20.0 20.0 20.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 287.0 567.0 7.0 mg/100 g Chocolate Type 2 specific 9244.0 11300.0 5230.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 380.0 380.0 380.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 192.666667 205.0 178.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 2249.0 12800.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 20350.0 20350.0 20350.0 mg/100 g Cocoa butter Type 2 specific 32600.0 32600.0 32600.0 mg/100 g Cocoa powder Type 2 specific 3223.333333 7280.0 1130.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 4154.78 5800.0 1960.0 mg/100 g Coffee Type 1 generic Coffea 13442 2.5 15.0 0.0 mg/100 g Cold cut Type 2 specific 538.75 1040.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 22203.0 22203.0 22203.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 4310.0 6250.0 2370.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 43.668182 229.2 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 230.7 992.5 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 6.333333 18.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 2440.325 4810.0 70.65 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 49882.5 49882.5 49882.5 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 4.0 5.0 3.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 529.65 529.65 529.65 mg/100 g Common pea Type 1 specific Pisum sativum 3888 75.664286 158.0 0.0 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 3550.0 3550.0 3550.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 488.8 488.8 488.8 mg/100 g Common walnut Type 1 specific Juglans regia 51240 12315.0 12315.0 12315.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 Coriander Type 1 specific Coriandrum sativum 4047 6952.6125 13500.0 273.0 mg/100 g Corn Type 1 specific Zea mays 4577 3793.625 27400.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 10947.75 17000.0 4895.5 mg/100 g Crab Type 1 specific Brachyura 6752 352.666667 618.0 220.0 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 4201.111111 8770.0 2000.0 mg/100 g Crisp bread Type 2 specific 573.6 2280.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 3293.811111 14810.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 29.95 117.75 2.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 13.0 16.0 10.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 2062.5 4125.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 373.5 747.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 4631.604938 20900.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 3060.5 5950.0 171.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 17.85 53.55 0.0 mg/100 g Eggs Unknown generic 6340.0 19500.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 31.666667 33.0 29.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 14.066667 34.2 4.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 7415.5875 28044.0 17.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 3250.0 3250.0 3250.0 mg/100 g Fats and oils Unknown generic Fennel Type 1 specific Foeniculum vulgare 48038 5481.866667 9910.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 1451.79 5346.0 51.0 mg/100 g Fish oil Type 1 8140.0 8140.0 8140.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 266.0 266.0 266.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 11173.333333 20200.0 5370.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruits Unknown generic Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 5519.928571 33100.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 4388.833333 12682.5 30.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 123.0 123.0 123.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 16.0 16.0 16.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 107.75 558.0 6.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 271.7 271.7 271.7 mg/100 g Garfish Type 1 specific Belone belone 129037 410.0 410.0 410.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 14.5 18.0 11.0 mg/100 g Gelatin Type 2 specific 34.0 34.0 34.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Ginger Type 1 specific Zingiber officinale 94328 366.75 609.5 124.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 148.35 235.7 61.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 353.6 353.6 353.6 mg/100 g Grape Type 1 specific Vitis 3603 4576.5 18200.0 3.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 32.0 48.0 16.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 7.0 7.0 7.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 100.3 192.6 8.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 65.375 117.75 13.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 2943.333333 3690.0 2560.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 1015.4 2790.0 43.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 43.0 129.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 37800.0 37800.0 37800.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Horseradish Type 1 specific Armoracia rusticana 3704 37.0 62.0 12.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 23272.5 23272.5 23272.5 mg/100 g Hot chocolate Type 2 specific 248.25 393.0 111.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 439.1 439.1 439.1 mg/100 g Ice cream Type 2 specific 742.5 2250.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 12.0 12.0 12.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 Jute Type 1 specific Corchorus olitorius 93759 625.75 1187.5 64.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 799.0 799.0 799.0 mg/100 g Ketchup Type 2 specific 134.5 269.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 24.75 42.5 7.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 337.0 337.0 337.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 38400.0 38400.0 38400.0 mg/100 g Leavening agent Type 2 specific 144.0 576.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 14.0 14.0 14.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 24.0 61.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 124.0 126.0 122.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 84.708333 225.25 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 20.7 79.5 3.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 109.0 109.0 109.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 47.0 76.0 18.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 77.5 133.0 22.0 mg/100 g Liquor Type 2 specific 425.75 3370.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 8.0 8.0 8.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 4695.0 6650.0 2740.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 44441.0 44441.0 44441.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 16.0 16.0 16.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 86.633333 135.9 47.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 136.75 174.5 99.0 mg/100 g Margarine Type 2 specific 17220.0 25900.0 6920.0 mg/100 g Margarine-like spread Type 2 specific 26000.0 26000.0 26000.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 173.333333 390.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 8900.0 17800.0 0.0 mg/100 g Meat bouillon Type 2 specific 705.4 3110.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 3405.811353 25384.0353 5.76 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 1070.0 1070.0 1070.0 mg/100 g Milk and milk products Unknown generic Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 135.9 135.9 135.9 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 325.0 325.0 325.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 12.75 12.75 12.75 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 111.4125 165.0 24.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 4322.333333 14085.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 26.5 26.5 26.5 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 178.0 178.0 178.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 4725.0 9450.0 0.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 1675.0 2340.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 24000.0 36600.0 11400.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 16.0 16.0 16.0 mg/100 g Olive Type 1 specific Olea europaea 4146 25758.0 73700.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 6405.1 6405.1 6405.1 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 192.6 192.6 192.6 mg/100 g Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 39500.0 53500.0 25500.0 mg/100 g Other bread Type 2 specific 854.777778 1480.0 0.0 mg/100 g Other bread product Type 2 specific 130.0 260.0 0.0 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 983.333333 2950.0 0.0 mg/100 g Other fermented milk Type 2 specific 788.0 799.0 777.0 mg/100 g Other fish product Type 2 specific 8140.0 8140.0 8140.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 1940.0 1940.0 1940.0 mg/100 g Other snack food Type 2 specific 8026.666667 9980.0 6920.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 65.0 65.0 65.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 138.0 138.0 138.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 14.0 14.0 14.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 6641.6 19797.25 38.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 1785.666667 5300.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 3989.5 7951.0 28.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 2185.0 4370.0 0.0 mg/100 g Pasta Type 2 specific 178.333333 304.0 42.0 mg/100 g Pastry Type 2 specific 5411.363636 13200.0 0.0 mg/100 g Pate Type 2 specific 8600.0 8600.0 8600.0 mg/100 g Peach Type 1 specific Prunus persica 3760 160.9375 308.0 60.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 27816.35 44500.0 20000.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 112.55 290.65 20.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 41233.333333 43300.0 40200.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 33.7 192.6 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 50.4 50.4 50.4 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 725.225 1450.45 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 25.05 25.05 25.05 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 19500.0 19500.0 19500.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 42.23 189.15 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 27192.0 35476.0 22600.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 119.666667 249.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Poppy Type 1 specific Papaver 3468 6170.0 6170.0 6170.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 3056.536364 13100.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 89.0 119.0 27.0 mg/100 g Purslane Type 1 specific Portulaca oleracea 46147 2551.15 4993.5 108.8 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 27.0 27.0 27.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 710.0 710.0 710.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 163.0 163.0 163.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 425.5 851.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 55950.0 58100.0 53800.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 47.9875 119.95 15.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 102.3 192.6 12.0 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 98.44 248.0 15.0 mg/100 g Remoulade Type 2 specific 15050.0 19000.0 11100.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 283.444444 705.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 2.5 15.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 45.428571 103.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 126.541667 297.25 0.0 mg/100 g Rye bread Type 2 specific 655.117647 1480.0 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 82.725 124.95 40.5 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 33393.0 75000.0 10879.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Salad dressing Type 2 specific 8665.833333 41900.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 1472.0 2570.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 26.333333 79.0 0.0 mg/100 g Sausage Type 2 specific 8838.235294 20600.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 7.0 7.0 7.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 2270.0 3370.0 1470.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 2528.166667 4401.0 1268.0 mg/100 g Semolina Type 2 specific 147.0 147.0 147.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 24241.8 39300.0 18700.0 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 7147.777778 12900.0 1960.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 Shrimp Type 1 specific Caridea 6694 109.333333 120.0 98.0 mg/100 g Small-leaf linden Type 1 specific Tilia cordata 172266 Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 328.0 328.0 328.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 8811.05 17290.0 332.1 mg/100 g Soy bean Type 1 specific Glycine max 3847 5162.833333 21300.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 7.0 7.0 7.0 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 Spinach Type 1 specific Spinacia oleracea 3562 21.55 24.65 19.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 51.25 83.0 14.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 160.5 160.5 160.5 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 442.5 885.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer savory Type 1 specific Satureja hortensis 49987 5040.0 5040.0 5040.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 117.75 117.75 117.75 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 16800.0 22000.0 10700.0 mg/100 g Swede Type 1 specific Brassica napus 3708 12.0 12.0 12.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 Sweet bay Type 1 specific Laurus nobilis 85223 Sweet marjoram Type 1 specific Origanum majorana 268884 800.0 800.0 800.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 54.375 110.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 10.6875 25.75 2.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 14163.333333 34300.0 2140.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 734.933333 1822.4 160.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 137.25 239.25 35.25 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 14300.0 14300.0 14300.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 897.5 2260.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Towel gourd Type 1 specific Luffa aegyptiaca 3670 5069.25 9750.0 388.5 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 538.75 1040.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 4928.0 4928.0 4928.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 32.0 32.0 32.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 22200.0 22200.0 22200.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 6505.5 13000.0 11.0 mg/100 g Wax gourd Type 1 specific Benincasa hispida 102211 492.75 492.75 492.75 mg/100 g Wheat Type 1 specific Triticum 4564 2518.428571 12500.0 220.0 mg/100 g Wheat bread Type 2 specific 475.0 1040.0 0.0 mg/100 g Whey Type 2 specific 2118.333333 6000.0 89.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 1380.0 1380.0 1380.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 93.4 93.4 93.4 mg/100 g White lupine Type 1 specific Lupinus albus 3870 3765.25 3765.25 3765.25 mg/100 g White mustard Type 1 specific Sinapis alba 3728 6113.8 6113.8 6113.8 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 7166.25 14305.0 27.5 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 5243.666667 15450.0 27.0 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 1450.633333 3208.2 388.3 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 12806.5 12806.5 12806.5 mg/100 g Yam Type 1 specific Dioscorea 4672 6.0 6.0 6.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 108.075 119.25 96.9 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 192.6 192.6 192.6 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 117.75 117.75 117.75 mg/100 g Ymer Type 2 specific 616.5 833.0 400.0 mg/100 g Yogurt Type 2 specific 642.3 1710.0 0.0 mg/100 g faint fat fatty fried lard waxy 2-acylglycerol O-acyltransferase 2 Q3SYC2 MOGAT2 Acyl-coenzyme A thioesterase 1 Q86TX2 ACOT1 Acyl-coenzyme A thioesterase 2, mitochondrial P49753 ACOT2 Acyl-coenzyme A thioesterase 4 Q8N9L9 ACOT4 Acyl-coenzyme A thioesterase 8 O14734 ACOT8 Bile acid-CoA:amino acid N-acyltransferase Q14032 BAAT Cytosolic acyl coenzyme A thioester hydrolase O00154 ACOT7 Fatty acid synthase P49327 FASN Fatty-acid amide hydrolase 1 O00519 FAAH Fatty-acid amide hydrolase 2 Q6GMR7 FAAH2 S-acyl fatty acid synthase thioesterase, medium chain Q9NV23 OLAH 5-alpha-reductase inhibitor 7 An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD(+) or NADP(+) as acceptor) inhibitor that interferes with the action of of 3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+)), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5alpha-dihydrotestosterone. Allergenic 43 A chemical compound which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. Alpha-reductase inhibitor 46 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. Anemiagenic 61 Anti leukotriene-D4 401 A substance that diminishes the rate of a chemical reaction. Anti-alopecic 104 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti-androgenic 112 A compound which inhibits or antagonises the biosynthesis or actions of androgens. Anti-inflammatory 370 A substance that reduces or suppresses inflammation. Cancer preventive 754 A substance that inhibits or prevents the proliferation of neoplasms. Choleretic 801 Dermatitigenic 875 Hypocholesterolemic 1016 Insectifuge 1041 Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. Irritant 1055 Name 936 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. Percutaneostimulant 1204 Perfumery 1206 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. Tyrosine kinase inhibitor 1253