1.0 2010-04-08 22:11:26 UTC 2025-11-19 00:49:09 UTC FDB014720 (+)-Syringaresinol (+)-syringaresinol is a member of the class of compounds known as furanoid lignans. Furanoid lignans are lignans with a structure that contains either a tetrahydrofuran ring, a furan ring, or a furofuan ring system, that arises from the joining of the two phenylpropanoid units (+)-syringaresinol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). (+)-syringaresinol can be found in a number of food items such as radish (variety), grape wine, oat, and ginkgo nuts, which makes (+)-syringaresinol a potential biomarker for the consumption of these food products. (+)-Syringaresinol Syringaresinol C22H26O8 418.437 418.162767808 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3,5-dimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2,6-dimethoxyphenol (+)-syringaresinol 21453-69-0 [H][C@]12CO[C@H](C3=CC(OC)=C(O)C(OC)=C3)[C@@]1([H])CO[C@@H]2C1=CC(OC)=C(O)C(OC)=C1 InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 KOWMJRJXZMEZLD-HCIHMXRSSA-N belongs to the class of organic compounds known as furanoid lignans. These are lignans with a structure that contains either a tetrahydrofuran ring, a furan ring, or a furofuan ring system, that arises from the joining of the two phenylpropanoid units. Furanoid lignans Organic compounds Lignans, neolignans and related compounds Furanoid lignans Aromatic heteropolycyclic compounds Alkyl aryl ethers Anisoles Dialkyl ethers Dimethoxybenzenes Furofuran lignans Furofurans Hydrocarbon derivatives Methoxyphenols Oxacyclic compounds Phenoxy compounds Tetrahydrofurans Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Dialkyl ether Dimethoxybenzene Ether Furanoid lignan Furofuran Furofuran lignan skeleton Hydrocarbon derivative M-dimethoxybenzene Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol Phenol ether Phenoxy compound Tetrahydrofuran Lignans syringaresinol logp 2.23 ALOGPS logs -3.94 ALOGPS solubility 4.79e-02 g/l ALOGPS melting_point Mp 175° logp 1.96 ChemAxon pka_strongest_acidic 9 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3,5-dimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2,6-dimethoxyphenol ChemAxon average_mass 418.437 ChemAxon mono_mass 418.162767808 ChemAxon smiles [H][C@]12CO[C@H](C3=CC(OC)=C(O)C(OC)=C3)[C@@]1([H])CO[C@@H]2C1=CC(OC)=C(O)C(OC)=C1 ChemAxon formula C22H26O8 ChemAxon inchi InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 ChemAxon inchikey KOWMJRJXZMEZLD-HCIHMXRSSA-N ChemAxon polar_surface_area 95.84 ChemAxon refractivity 108.03 ChemAxon polarizability 41.87 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 8 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 104178 Specdb::MsMs 104179 Specdb::MsMs 104180 Specdb::MsMs 170394 Specdb::MsMs 170395 Specdb::MsMs 170396 Specdb::MsMs 3605746 Specdb::MsMs 3605747 Specdb::MsMs 3605748 Specdb::MsMs 3605749 Specdb::MsMs 3605750 Specdb::MsMs 3605751 47 Amaranth Type 1 specific Amaranthus 3564 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 Asparagus Type 1 specific Asparagus officinalis 4686 0.058 0.057999998 0.057999998 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.169 0.169 0.169 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 Breakfast cereal Type 2 specific Bulgur Type 2 specific Cereals and cereal products Unknown generic Cherimoya Type 1 specific Annona cherimola 49314 Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.248 0.247999996 0.247999996 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.372 0.372000009 0.372000009 mg/100 g Corn Type 1 specific Zea mays 4577 Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.002 0.002 0.002 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.002 0.002 0.002 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Grape wine Type 2 specific 0.0025 0.00355 0.00145 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 Kiwi Type 1 specific Actinidia chinensis 3625 0.008 0.008 0.008 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 Oat Type 1 specific Avena sativa 4498 0.352 0.351999998 0.351999998 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 Pineapple Type 1 specific Ananas comosus 4615 0.081 0.081 0.081 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 0.002 0.002 0.002 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 Rice Type 1 specific Oryza sativa 4530 Rye Type 1 specific Secale cereale 4550 0.973 0.97299999 0.97299999 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.205 0.204999998 0.204999998 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 Soy bean Type 1 specific Glycine max 3847 Spelt Type 1 specific Triticum spelta 58933 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Teff Type 1 specific Eragrostis tef 110835 Tofu Type 2 specific 0.0425 0.0425 0.0425 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui Wheat Type 1 specific Triticum 4564 Wild rice Type 1 specific Zizania 15949 Anti neoplastic 465 A substance that inhibits or prevents the proliferation of neoplasms.