1.0 2011-09-21 00:17:05 UTC 2015-07-21 06:57:17 UTC FDB022628 N-Acetyl-D-glucosaminyldiphosphodolichol This compound is an intermediate in N-glycan biosynthesis, and the byproduct of N-acetylglucosaminyldiphosphodolichol (EC 2.4.1.141) and UDP-N-acetylglucosamine-dolichyl-phosphate (EC 2.7.8.15). (KEGG) This compound and its corresponding enzymes are implicated in the developmental programmes of a variety of eukaryotes. (PMID: 10024536) [HMDB] N-Acetyl-D-glucosaminyl-diodolichol N-Acetyl-D-glucosaminyl-diphosphodolichol C23H43NO12P2 587.5345 587.226048869 {[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}({[hydroxy({[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yl]oxy})phosphoryl]oxy})phosphinic acid [(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy({hydroxy[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yl]oxyphosphoryl}oxy)phosphinic acid OC[C@H]1O[C@@H](OP(O)(=O)OP(O)(=O)OCCC(C)CC\C=C(/C)CCC=C(C)C)[C@H](NC(=O)C)[C@@H](O)[C@@H]1O InChI=1S/C23H43NO12P2/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-33-37(29,30)36-38(31,32)35-23-20(24-18(5)26)22(28)21(27)19(14-25)34-23/h8,10,17,19-23,25,27-28H,6-7,9,11-14H2,1-5H3,(H,24,26)(H,29,30)(H,31,32)/b16-10+/t17?,19-,20-,21-,22-,23+/m1/s1 OZGJPDIBINDRGZ-GKXPKBPWSA-N belongs to the class of organic compounds known as n-acyl-alpha-hexosamines. These are carbohydrate derivatives containing a hexose moiety in which the oxygen atom is replaced by an n-acyl group. N-acyl-alpha-hexosamines Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetamides Carbonyl compounds Hexoses Hydrocarbon derivatives Monoalkyl phosphates Monosaccharide phosphates Organic oxides Organic pyrophosphates Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Primary alcohols Secondary alcohols Secondary carboxylic acid amides Sesquiterpenoids Acetamide Alcohol Aliphatic heteromonocyclic compound Alkyl phosphate Carbonyl group Carboxamide group Carboxylic acid derivative Farsesane sesquiterpenoid Hexose monosaccharide Hydrocarbon derivative Monoalkyl phosphate Monosaccharide Monosaccharide phosphate N-acyl-alpha-hexosamine Organic nitrogen compound Organic oxide Organic phosphoric acid derivative Organic pyrophosphate Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Phosphoric acid ester Primary alcohol Secondary alcohol Secondary carboxylic acid amide Sesquiterpenoid Solid logp 1.30 ALOGPS logs -2.77 ALOGPS solubility 1.00e+00 g/l ALOGPS logp 1.54 ChemAxon pka_strongest_acidic 1.75 ChemAxon pka_strongest_basic -0.78 ChemAxon iupac {[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}({[hydroxy({[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yl]oxy})phosphoryl]oxy})phosphinic acid ChemAxon average_mass 587.5345 ChemAxon mono_mass 587.226048869 ChemAxon smiles OC[C@H]1O[C@@H](OP(O)(=O)OP(O)(=O)OCCC(C)CC\C=C(/C)CCC=C(C)C)[C@H](NC(=O)C)[C@@H](O)[C@@H]1O ChemAxon formula C23H43NO12P2 ChemAxon inchi InChI=1S/C23H43NO12P2/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-33-37(29,30)36-38(31,32)35-23-20(24-18(5)26)22(28)21(27)19(14-25)34-23/h8,10,17,19-23,25,27-28H,6-7,9,11-14H2,1-5H3,(H,24,26)(H,29,30)(H,31,32)/b16-10+/t17?,19-,20-,21-,22-,23+/m1/s1 ChemAxon inchikey OZGJPDIBINDRGZ-GKXPKBPWSA-N ChemAxon polar_surface_area 201.31 ChemAxon refractivity 139.28 ChemAxon polarizability 58.82 ChemAxon rotatable_bond_count 16 ChemAxon acceptor_count 9 ChemAxon donor_count 6 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 323170 Specdb::MsMs 323171 Specdb::MsMs 323172 Specdb::MsMs 371263 Specdb::MsMs 371264 Specdb::MsMs 371265 Specdb::MsMs 2382548 Specdb::MsMs 2382549 Specdb::MsMs 2382550 Specdb::MsMs 2580138 Specdb::MsMs 2580139 Specdb::MsMs 2580140 Specdb::CMs 25799 Specdb::CMs 38077 Specdb::CMs 282803 Specdb::CMs 412223 Specdb::CMs 412224 Specdb::CMs 412225 Specdb::CMs 412226 Specdb::CMs 412227 Specdb::CMs 412228 Specdb::CMs 412229 Specdb::CMs 412230 Specdb::CMs 412231 Specdb::CMs 412232 Specdb::CMs 412233 Specdb::CMs 412234 Specdb::CMs 412235 Specdb::CMs 412236 Specdb::CMs 412237 Specdb::CMs 412238 Specdb::CMs 412239 Specdb::CMs 412240 Specdb::CMs 412241 Specdb::CMs 412242 Specdb::CMs 412243 Specdb::CMs 412244 HMDB01445 18278 #<Reference:0x000055ce30c90f78> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 UDP-N-acetylglucosamine transferase subunit ALG13 homolog Q9NP73 ALG13 UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Q9H3H5 DPAGT1