1.0 2011-09-21 01:29:10 UTC 2016-06-28 20:13:33 UTC FDB027741 PG(16:1(9Z)/18:3(6Z,9Z,12Z)) PG(16:1(9Z)/18:3(6Z,9Z,12Z)) is a phosphatidylglycerol. Phosphatidylglycerols consist of a glycerol 3-phosphate backbone esterified to either saturated or unsaturated fatty acids on carbons 1 and 2. As is the case with diacylglycerols, phosphatidylglycerols can have many different combinations of fatty acids of varying lengths and saturation attached to the C-1 and C-2 positions. PG(16:1(9Z)/18:3(6Z,9Z,12Z)), in particular, consists of one 9Z-hexadecenoyl chain to the C-1 atom, and one 6Z,9Z,12Z-octadecatrienoyl to the C-2 atom. In E. coli glycerophospholipid metabolism, phosphatidylglycerol is formed from phosphatidic acid (1,2-diacyl-sn-glycerol 3-phosphate) by a sequence of enzymatic reactions that proceeds via two intermediates, cytidine diphosphate diacylglycerol (CDP-diacylglycerol) and phosphatidylglycerophosphate (PGP, a phosphorylated phosphatidylglycerol). Phosphatidylglycerols, along with CDP-diacylglycerol, also serve as precursor molecules for the synthesis of cardiolipin, a phospholipid found in membranes. 1-(9Z-Hexadecenoyl)-2-(6Z,9Z,12Z-octadecatrienoyl)-sn-glycero-3-O-(1'-glycerol) 1-(9Z-hexadecenoyl)-2-(6Z,9Z,12Z-octadecatrienoyl)-sn-glycero-3-phospho-(1'-glycerol) 1-Palmitoleoyl-2-g-linolenoyl-sn-glycero-3-oglycerol 1-palmitoleoyl-2-g-linolenoyl-sn-glycero-3-phosphoglycerol 1-Palmitoleoyl-2-gamma-linolenoyl-sn-glycero-3-oglycerol 1-palmitoleoyl-2-gamma-linolenoyl-sn-glycero-3-phosphoglycerol Atidylglycerol(16:1/18:3) Atidylglycerol(16:1N7/18:3N6) Atidylglycerol(16:1W7/18:3W6) Atidylglycerol(34:4) GPG(16:1/18:3) GPG(16:1n7/18:3n6) GPG(16:1w7/18:3w6) GPG(34:4) PG(16:1/18:3) PG(16:1n7/18:3n6) PG(16:1w7/18:3w6) PG(34:4) Phosphatidylglycerol(16:1n7/18:3n6) Phosphatidylglycerol(16:1w7/18:3w6) C40H71O10P 742.9595 742.478485004 [(2S)-2,3-dihydroxypropoxy][(2R)-3-[(9Z)-hexadec-9-enoyloxy]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyloxy]propoxy]phosphinic acid (2S)-2,3-dihydroxypropoxy(2R)-3-[(9Z)-hexadec-9-enoyloxy]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyloxy]propoxyphosphinic acid [H][C@](O)(CO)COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCCCC\C=C/CCCCCC)OC(=O)CCCC\C=C/C\C=C/C\C=C/CCCCC InChI=1S/C40H71O10P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-40(44)50-38(36-49-51(45,46)48-34-37(42)33-41)35-47-39(43)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h11,13-14,16-18,22,24,37-38,41-42H,3-10,12,15,19-21,23,25-36H2,1-2H3,(H,45,46)/b13-11-,16-14-,18-17-,24-22-/t37-,38+/m0/s1 WAMGBQWEVHZHEA-OZTJURSHSA-N belongs to the class of organic compounds known as phosphatidylglycerols. These are glycerophosphoglycerols in which two fatty acids are bonded to the 1-glycerol moiety through ester linkages. As is the case with diacylglycerols, phosphatidylglycerols can have many different combinations of fatty acids of varying lengths and saturation attached to the C-1 and C-2 positions. Phosphatidylglycerols Organic compounds Lipids and lipid-like molecules Glycerophospholipids Glycerophosphoglycerols Aliphatic acyclic compounds 1,2-diols Carbonyl compounds Carboxylic acid esters Dialkyl phosphates Dicarboxylic acids and derivatives Fatty acid esters Hydrocarbon derivatives Organic oxides Primary alcohols Secondary alcohols 1,2-diacylglycerophosphoglycerol 1,2-diol Alcohol Aliphatic acyclic compound Alkyl phosphate Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dialkyl phosphate Dicarboxylic acid or derivatives Fatty acid ester Fatty acyl Hydrocarbon derivative Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organooxygen compound Phosphoric acid ester Primary alcohol Secondary alcohol Diacylglycerophosphoglycerols Solid logp 7.50 ALOGPS logs -6.75 ALOGPS solubility 1.32e-04 g/l ALOGPS logp 10.38 ChemAxon pka_strongest_acidic 1.89 ChemAxon pka_strongest_basic -3 ChemAxon iupac [(2S)-2,3-dihydroxypropoxy][(2R)-3-[(9Z)-hexadec-9-enoyloxy]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyloxy]propoxy]phosphinic acid ChemAxon average_mass 742.9595 ChemAxon mono_mass 742.478485004 ChemAxon smiles [H][C@](O)(CO)COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCCCC\C=C/CCCCCC)OC(=O)CCCC\C=C/C\C=C/C\C=C/CCCCC ChemAxon formula C40H71O10P ChemAxon inchi InChI=1S/C40H71O10P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-40(44)50-38(36-49-51(45,46)48-34-37(42)33-41)35-47-39(43)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h11,13-14,16-18,22,24,37-38,41-42H,3-10,12,15,19-21,23,25-36H2,1-2H3,(H,45,46)/b13-11-,16-14-,18-17-,24-22-/t37-,38+/m0/s1 ChemAxon inchikey WAMGBQWEVHZHEA-OZTJURSHSA-N ChemAxon polar_surface_area 148.82 ChemAxon refractivity 208.98 ChemAxon polarizability 86.72 ChemAxon rotatable_bond_count 38 ChemAxon acceptor_count 6 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 307894 Specdb::MsMs 307895 Specdb::MsMs 307896 Specdb::MsMs 351943 Specdb::MsMs 351944 Specdb::MsMs 351945 Specdb::MsMs 2792126 Specdb::MsMs 2792127 Specdb::MsMs 2792128 Specdb::CMs 772654 Specdb::CMs 772655 Specdb::CMs 772656 Specdb::CMs 772657 Specdb::CMs 772658 Specdb::CMs 772659 Specdb::CMs 772660 Specdb::CMs 772661 Specdb::CMs 772662 HMDB10591 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 Q92604 LPGAT1