1.0 2011-09-21 01:44:47 UTC 2015-07-21 06:59:32 UTC FDB028775 (+)-(1R,2R)-1,2-Diphenylethane-1,2-diol (+)-(1R,2R)-1,2-Diphenylethane-1,2-diol is converted from cis-stilbene oxide via the enzyme microsomal epoxide hydrolase (EC 3.3.2.9). This is a key hepatic enzyme that is involved in the metabolism of numerous xenobiotics, such as 1,3-butadiene oxide, styrene oxide and the polycyclic aromatic hydrocarbon benzo[a]pyrene 4,5-oxide. [HMDB] (+)-Hydrobenzoin (R,R)-(+)-Hydrobenzoin C14H14O2 214.2598 214.099379692 (1R,2R)-1,2-diphenylethane-1,2-diol (+)-hydrobenzoin 52340-78-0 O[C@@H]([C@H](O)C1=CC=CC=C1)C1=CC=CC=C1 InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m1/s1 IHPDTPWNFBQHEB-ZIAGYGMSSA-N belongs to the class of organic compounds known as stilbenes. These are organic compounds containing a 1,2-diphenylethylene moiety. Stilbenes (C6-C2-C6 ) are derived from the common phenylpropene (C6-C3) skeleton building block. The introduction of one or more hydroxyl groups to a phenyl ring lead to stilbenoids. Stilbenes Organic compounds Phenylpropanoids and polyketides Stilbenes Aromatic homomonocyclic compounds 1,2-diols Aromatic alcohols Benzene and substituted derivatives Hydrocarbon derivatives Secondary alcohols 1,2-diol Alcohol Aromatic alcohol Aromatic homomonocyclic compound Benzenoid Hydrocarbon derivative Monocyclic benzene moiety Organic oxygen compound Organooxygen compound Secondary alcohol Stilbene hydrobenzoin Solid logp 2.05 ALOGPS logs -2.16 ALOGPS solubility 1.48e+00 g/l ALOGPS logp 2.36 ChemAxon pka_strongest_acidic 13.08 ChemAxon pka_strongest_basic -3.5 ChemAxon iupac (1R,2R)-1,2-diphenylethane-1,2-diol ChemAxon average_mass 214.2598 ChemAxon mono_mass 214.099379692 ChemAxon smiles O[C@@H]([C@H](O)C1=CC=CC=C1)C1=CC=CC=C1 ChemAxon formula C14H14O2 ChemAxon inchi InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m1/s1 ChemAxon inchikey IHPDTPWNFBQHEB-ZIAGYGMSSA-N ChemAxon polar_surface_area 40.46 ChemAxon refractivity 63.12 ChemAxon polarizability 22.85 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 21184 Specdb::CMs 39815 Specdb::CMs 153617 Specdb::MsMs 313153 Specdb::MsMs 313154 Specdb::MsMs 313155 Specdb::MsMs 358585 Specdb::MsMs 358586 Specdb::MsMs 358587 Specdb::MsMs 2329866 Specdb::MsMs 2329867 Specdb::MsMs 2329868 Specdb::MsMs 2635276 Specdb::MsMs 2635277 Specdb::MsMs 2635278 HMDB12111 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Epoxide hydrolase 1 P07099 EPHX1