1.0 2020-04-06 11:04:50 UTC 2025-11-19 03:10:32 UTC FDB111666 3,4-Dimethoxyphenylethylamine C10H15NO2 181.2316 181.110278729 2-(3,4-dimethoxyphenyl)ethan-1-amine dimethoxyphenylethylamine COC1=C(OC)C=C(CCN)C=C1 InChI=1S/C10H15NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5-6,11H2,1-2H3 ANOUKFYBOAKOIR-UHFFFAOYSA-N belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. Dimethoxybenzenes Organic compounds Benzenoids Benzene and substituted derivatives Methoxybenzenes Aromatic homomonocyclic compounds 2-arylethylamines Alkyl aryl ethers Anisoles Aralkylamines Hydrocarbon derivatives Monoalkylamines Organopnictogen compounds Phenethylamines Phenoxy compounds 2-arylethylamine Alkyl aryl ether Amine Anisole Aralkylamine Aromatic homomonocyclic compound Dimethoxybenzene Ether Hydrocarbon derivative O-dimethoxybenzene Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenethylamine Phenol ether Phenoxy compound Primary aliphatic amine Primary amine alkaloid aromatic ether phenylethylamine logp 0.90 ALOGPS logs -2.06 ALOGPS solubility 1.59e+00 g/l ALOGPS logp 1.07 ChemAxon pka_strongest_basic 9.8 ChemAxon iupac 2-(3,4-dimethoxyphenyl)ethan-1-amine ChemAxon average_mass 181.2316 ChemAxon mono_mass 181.110278729 ChemAxon smiles COC1=C(OC)C=C(CCN)C=C1 ChemAxon formula C10H15NO2 ChemAxon inchi InChI=1S/C10H15NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5-6,11H2,1-2H3 ChemAxon inchikey ANOUKFYBOAKOIR-UHFFFAOYSA-N ChemAxon polar_surface_area 44.48 ChemAxon refractivity 52.21 ChemAxon polarizability 20.18 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 24068 Specdb::CMs 27375 Specdb::CMs 29045 Specdb::CMs 29841 Specdb::CMs 102266 Specdb::CMs 102267 Specdb::CMs 102268 Specdb::CMs 146036 Specdb::MsIr 9393 Specdb::MsIr 9394 Specdb::MsIr 9395 Specdb::MsMs 319330 Specdb::MsMs 319331 Specdb::MsMs 319332 Specdb::MsMs 366406 Specdb::MsMs 366407 Specdb::MsMs 366408 Specdb::MsMs 451050 Specdb::MsMs 2246611 Specdb::MsMs 2431255 Specdb::MsMs 2431256 Specdb::MsMs 2431257 Specdb::MsMs 2507680 Specdb::MsMs 2507681 Specdb::MsMs 2507682 HMDB0041806 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823