1.0 2020-04-06 11:45:56 UTC 2025-11-19 03:10:56 UTC FDB111901 Hydroxyprolyl-Serine C8H14N2O5 218.2072 218.090271568 3-hydroxy-2-[(4-hydroxypyrrolidin-2-yl)formamido]propanoic acid 3-hydroxy-2-[(4-hydroxypyrrolidin-2-yl)formamido]propanoic acid OCC(NC(=O)C1CC(O)CN1)C(O)=O InChI=1S/C8H14N2O5/c11-3-6(8(14)15)10-7(13)5-1-4(12)2-9-5/h4-6,9,11-12H,1-3H2,(H,10,13)(H,14,15) UVSBYUFDCGZIMR-UHFFFAOYSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds 1,2-aminoalcohols Alpha amino acid amides Amino acids Azacyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Primary alcohols Proline and derivatives Pyrrolidinecarboxamides Secondary alcohols Secondary carboxylic acid amides Serine and derivatives 1,2-aminoalcohol Alcohol Aliphatic heteromonocyclic compound Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Azacycle Beta-hydroxy acid Carbonyl group Carboxamide group Carboxylic acid Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary alcohol Proline or derivatives Pyrrolidine Pyrrolidine carboxylic acid or derivatives Pyrrolidine-2-carboxamide Secondary alcohol Secondary aliphatic amine Secondary amine Secondary carboxylic acid amide Serine or derivatives logp -3.56 ALOGPS logs -0.77 ALOGPS solubility 3.70e+01 g/l ALOGPS logp -5.3 ChemAxon pka_strongest_acidic 3.34 ChemAxon pka_strongest_basic 9.11 ChemAxon iupac 3-hydroxy-2-[(4-hydroxypyrrolidin-2-yl)formamido]propanoic acid ChemAxon average_mass 218.2072 ChemAxon mono_mass 218.090271568 ChemAxon smiles OCC(NC(=O)C1CC(O)CN1)C(O)=O ChemAxon formula C8H14N2O5 ChemAxon inchi InChI=1S/C8H14N2O5/c11-3-6(8(14)15)10-7(13)5-1-4(12)2-9-5/h4-6,9,11-12H,1-3H2,(H,10,13)(H,14,15) ChemAxon inchikey UVSBYUFDCGZIMR-UHFFFAOYSA-N ChemAxon polar_surface_area 118.89 ChemAxon refractivity 48.22 ChemAxon polarizability 20.83 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22303 Specdb::CMs 40926 Specdb::CMs 120508 Specdb::CMs 122001 Specdb::CMs 164918 Specdb::NmrOneD 155530 Specdb::NmrOneD 155531 Specdb::NmrOneD 155532 Specdb::NmrOneD 155533 Specdb::NmrOneD 155534 Specdb::NmrOneD 155535 Specdb::NmrOneD 155536 Specdb::NmrOneD 155537 Specdb::NmrOneD 155538 Specdb::NmrOneD 155539 Specdb::NmrOneD 155540 Specdb::NmrOneD 155541 Specdb::NmrOneD 155542 Specdb::NmrOneD 155543 Specdb::NmrOneD 155544 Specdb::NmrOneD 155545 Specdb::NmrOneD 155546 Specdb::NmrOneD 155547 Specdb::NmrOneD 155548 Specdb::NmrOneD 155549 Specdb::MsMs 315514 Specdb::MsMs 315515 Specdb::MsMs 315516 Specdb::MsMs 361522 Specdb::MsMs 361523 Specdb::MsMs 361524 Specdb::MsMs 2429947 Specdb::MsMs 2429948 Specdb::MsMs 2429949 Specdb::MsMs 2506235 Specdb::MsMs 2506236 Specdb::MsMs 2506237 HMDB0028872 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823