1.0 2026-09-21 16:12:55 UTC 2026-09-21 16:12:55 UTC FDB116711 cis-2-Methoxycinnamic acid (Z)-3-(2-methoxyphenyl)prop-2-enoic acid C10H10O3 178.1846 178.062994186 (2Z)-3-(2-methoxyphenyl)prop-2-enoic acid (2Z)-3-(2-methoxyphenyl)prop-2-enoic acid [H]\C(=C(/[H])C1=CC=CC=C1OC)C(O)=O InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6- FEGVSPGUHMGGBO-SREVYHEPSA-N belongs to the class of organic compounds known as coumaric acids. These are aromatic compounds containing a cinnamic acid moiety hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Coumaric acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Styrenes Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid Ether Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Styrene logp 2.38 ALOGPS logs -2.45 ALOGPS solubility 6.38e-01 g/l ALOGPS logp 1.98 ChemAxon pka_strongest_acidic 3.64 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac (2Z)-3-(2-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 178.1846 ChemAxon mono_mass 178.062994186 ChemAxon smiles [H]\C(=C(/[H])C1=CC=CC=C1OC)C(O)=O ChemAxon formula C10H10O3 ChemAxon inchi InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6- ChemAxon inchikey FEGVSPGUHMGGBO-SREVYHEPSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 49.52 ChemAxon polarizability 18.17 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1299