1.0 2026-09-21 17:41:59 UTC 2026-09-21 17:41:59 UTC FDB116828 METHYL HENEICOSANOATE methyl henicosanoate C22H44O2 340.5836 340.334130652 methyl henicosanoate methyl henicosanoate CCCCCCCCCCCCCCCCCCCCC(=O)OC InChI=1S/C22H44O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-2/h3-21H2,1-2H3 AJRICDSAJQHDSD-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid methyl esters. Fatty acid methyl esters are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. Fatty acid methyl esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid methyl ester Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 9.38 ALOGPS logs -7.30 ALOGPS solubility 1.72e-05 g/l ALOGPS logp 8.63 ChemAxon pka_strongest_basic -7 ChemAxon iupac methyl henicosanoate ChemAxon average_mass 340.5836 ChemAxon mono_mass 340.334130652 ChemAxon smiles CCCCCCCCCCCCCCCCCCCCC(=O)OC ChemAxon formula C22H44O2 ChemAxon inchi InChI=1S/C22H44O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-2/h3-21H2,1-2H3 ChemAxon inchikey AJRICDSAJQHDSD-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 104.86 ChemAxon polarizability 47.33 ChemAxon rotatable_bond_count 20 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1972