1.0 2026-09-21 19:01:15 UTC 2026-09-21 19:01:15 UTC FDB116935 Indole-4-carboxaldehyde 1H-indole-4-carbaldehyde C9H7NO 145.161 145.052763849 1H-indole-4-carbaldehyde 1H-indole-4-carbaldehyde O=CC1=C2C=CNC2=CC=C1 InChI=1S/C9H7NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1-6,10H JFDDFGLNZWNJTK-UHFFFAOYSA-N belongs to the class of organic compounds known as indoles. Indoles are compounds containing an indole moiety, which consists of pyrrole ring fused to benzene to form 2,3-benzopyrrole. Indoles Organic compounds Organoheterocyclic compounds Indoles and derivatives Indoles Aromatic heteropolycyclic compounds Aryl-aldehydes Azacyclic compounds Benzenoids Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Pyrroles Aldehyde Aromatic heteropolycyclic compound Aryl-aldehyde Azacycle Benzenoid Heteroaromatic compound Hydrocarbon derivative Indole Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole logp 1.83 ALOGPS logs -1.76 ALOGPS solubility 2.53e+00 g/l ALOGPS logp 1.78 ChemAxon pka_strongest_acidic 15.11 ChemAxon pka_strongest_basic -7.2 ChemAxon iupac 1H-indole-4-carbaldehyde ChemAxon average_mass 145.161 ChemAxon mono_mass 145.052763849 ChemAxon smiles O=CC1=C2C=CNC2=CC=C1 ChemAxon formula C9H7NO ChemAxon inchi InChI=1S/C9H7NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1-6,10H ChemAxon inchikey JFDDFGLNZWNJTK-UHFFFAOYSA-N ChemAxon polar_surface_area 32.86 ChemAxon refractivity 43.73 ChemAxon polarizability 14.93 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon