1.0 2026-09-21 23:01:35 UTC 2026-09-21 23:01:35 UTC FDB117236 4-(Aminomethyl)cyclohexanecarboxylic acid 4-(aminomethyl)cyclohexane-1-carboxylic acid 4-(aminomethyl)cyclohexanecarboxylic acid C8H15NO2 157.213 157.110278727 4-(aminomethyl)cyclohexane-1-carboxylic acid tranexamic acid NCC1CCC(CC1)C(O)=O InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11) GYDJEQRTZSCIOI-UHFFFAOYSA-N belongs to the class of organic compounds known as amino acids. These are organic compounds that contain at least one carboxyl group and one amino group. Amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic homomonocyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic homomonocyclic compound Amine Amino acid Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine logp -1.42 ALOGPS logs -0.94 ALOGPS solubility 1.82e+01 g/l ALOGPS logp -1.6 ChemAxon pka_strongest_acidic 4.56 ChemAxon pka_strongest_basic 10.22 ChemAxon iupac 4-(aminomethyl)cyclohexane-1-carboxylic acid ChemAxon average_mass 157.213 ChemAxon mono_mass 157.110278727 ChemAxon smiles NCC1CCC(CC1)C(O)=O ChemAxon formula C8H15NO2 ChemAxon inchi InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11) ChemAxon inchikey GYDJEQRTZSCIOI-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 41.9 ChemAxon polarizability 17.49 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 98730 Specdb::MsMs 98731 Specdb::MsMs 98732 Specdb::MsMs 163713 Specdb::MsMs 163714 Specdb::MsMs 163715