1.0 2026-09-22 04:29:03 UTC 2026-09-22 04:29:03 UTC FDB117703 METOXURON 3-(3-chloro-4-methoxy-phenyl)-1,1-dimethyl-urea 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea C10H13ClN2O2 228.68 228.0665554 N'-(3-chloro-4-methoxyphenyl)-N,N-dimethylcarbamimidic acid deftor COC1=C(Cl)C=C(C=C1)N=C(O)N(C)C InChI=1S/C10H13ClN2O2/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7/h4-6H,1-3H3,(H,12,14) DSRNRYQBBJQVCW-UHFFFAOYSA-N belongs to the class of organic compounds known as n-phenylureas. N-phenylureas are compounds containing a N-phenylurea moiety, which is structurally characterized by a phenyl group linked to one nitrogen atom of a urea group. N-phenylureas Organic compounds Benzenoids Benzene and substituted derivatives N-phenylureas Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Aryl chlorides Carbonyl compounds Chlorobenzenes Hydrocarbon derivatives Methoxyanilines Methoxybenzenes Organic oxides Organochlorides Organonitrogen compounds Organopnictogen compounds Phenoxy compounds Ureas Alkyl aryl ether Anisole Aromatic homomonocyclic compound Aryl chloride Aryl halide Carbonic acid derivative Carbonyl group Chlorobenzene Ether Halobenzene Hydrocarbon derivative Methoxyaniline Methoxybenzene N-phenylurea Organic nitrogen compound Organic oxide Organic oxygen compound Organochloride Organohalogen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol ether Phenoxy compound Urea Phenylurea herbicides ureas logp 2.09 ALOGPS logs -2.63 ALOGPS solubility 5.35e-01 g/l ALOGPS logp 1.54 ChemAxon pka_strongest_acidic -2.5 ChemAxon pka_strongest_basic 15 ChemAxon iupac N'-(3-chloro-4-methoxyphenyl)-N,N-dimethylcarbamimidic acid ChemAxon average_mass 228.68 ChemAxon mono_mass 228.0665554 ChemAxon smiles COC1=C(Cl)C=C(C=C1)N=C(O)N(C)C ChemAxon formula C10H13ClN2O2 ChemAxon inchi InChI=1S/C10H13ClN2O2/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7/h4-6H,1-3H3,(H,12,14) ChemAxon inchikey DSRNRYQBBJQVCW-UHFFFAOYSA-N ChemAxon polar_surface_area 45.06 ChemAxon refractivity 61.81 ChemAxon polarizability 23.26 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1305430 Specdb::MsMs 1305431 Specdb::MsMs 1305432 Specdb::MsMs 1419955 Specdb::MsMs 1419956 Specdb::MsMs 1419957