1.0 2026-09-22 04:42:45 UTC 2026-09-22 04:42:45 UTC FDB117721 2,2',5-TRICHLOROBIPHENYL 1,4-dichloro-2-(2-chlorophenyl)benzene C12H7Cl3 257.543 255.961333345 1,4-dichloro-2-(2-chlorophenyl)benzene trichlorobiphenyl ClC1=CC=C(Cl)C(=C1)C1=CC=CC=C1Cl InChI=1S/C12H7Cl3/c13-8-5-6-12(15)10(7-8)9-3-1-2-4-11(9)14/h1-7H DCMURXAZTZQAFB-UHFFFAOYSA-N belongs to the class of organic compounds known as polychlorinated biphenyls. These are organic compounds containing at least two chlorine atoms attached to either benzene ring of the biphenyl moiety. Polychlorinated biphenyls Organic compounds Benzenoids Benzene and substituted derivatives Biphenyls and derivatives Aromatic homomonocyclic compounds Aryl chlorides Dichlorobenzenes Hydrocarbon derivatives Organochlorides 1,4-dichlorobenzene Aromatic homomonocyclic compound Aryl chloride Aryl halide Chlorobenzene Halobenzene Hydrocarbon derivative Organochloride Organohalogen compound Polychlorinated biphenyl logp 5.71 ALOGPS logs -6.31 ALOGPS solubility 1.26e-04 g/l ALOGPS logp 5.43 ChemAxon iupac 1,4-dichloro-2-(2-chlorophenyl)benzene ChemAxon average_mass 257.543 ChemAxon mono_mass 255.961333345 ChemAxon smiles ClC1=CC=C(Cl)C(=C1)C1=CC=CC=C1Cl ChemAxon formula C12H7Cl3 ChemAxon inchi InChI=1S/C12H7Cl3/c13-8-5-6-12(15)10(7-8)9-3-1-2-4-11(9)14/h1-7H ChemAxon inchikey DCMURXAZTZQAFB-UHFFFAOYSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 65.61 ChemAxon polarizability 24.21 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 487 Specdb::CMs 115691 Specdb::CMs 130142 Specdb::NmrOneD 2367 Specdb::NmrOneD 3060 Specdb::MsMs 59628 Specdb::MsMs 59629 Specdb::MsMs 59630 Specdb::MsMs 115809 Specdb::MsMs 115810 Specdb::MsMs 115811 Specdb::MsMs 3400639 Specdb::MsMs 3400640 Specdb::MsMs 3400641 Specdb::MsMs 3400642 Specdb::MsMs 3400643 Specdb::MsMs 3400644