1.0 2026-09-22 05:03:53 UTC 2026-09-22 05:03:53 UTC FDB117745 Butyl octyl phthalate 1-O-butyl 2-O-octyl benzene-1,2-dicarboxylate O1-butyl O2-octyl benzene-1,2-dicarboxylate C20H30O4 334.456 334.214409446 1-butyl 2-octyl benzene-1,2-dicarboxylate 1-butyl 2-octyl phthalate CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC InChI=1S/C20H30O4/c1-3-5-7-8-9-12-16-24-20(22)18-14-11-10-13-17(18)19(21)23-15-6-4-2/h10-11,13-14H,3-9,12,15-16H2,1-2H3 MURWRBWZIMXKGC-UHFFFAOYSA-N belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. Benzoic acid esters Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Benzoyl derivatives Carboxylic acid esters Dicarboxylic acids and derivatives Hydrocarbon derivatives Organic oxides Organooxygen compounds Aromatic homomonocyclic compound Benzoate ester Benzoyl Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Hydrocarbon derivative Organic oxide Organic oxygen compound Organooxygen compound logp 6.47 ALOGPS logs -5.96 ALOGPS solubility 3.64e-04 g/l ALOGPS logp 6.41 ChemAxon pka_strongest_basic -6.7 ChemAxon iupac 1-butyl 2-octyl benzene-1,2-dicarboxylate ChemAxon average_mass 334.456 ChemAxon mono_mass 334.214409446 ChemAxon smiles CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC ChemAxon formula C20H30O4 ChemAxon inchi InChI=1S/C20H30O4/c1-3-5-7-8-9-12-16-24-20(22)18-14-11-10-13-17(18)19(21)23-15-6-4-2/h10-11,13-14H,3-9,12,15-16H2,1-2H3 ChemAxon inchikey MURWRBWZIMXKGC-UHFFFAOYSA-N ChemAxon polar_surface_area 52.6 ChemAxon refractivity 96.26 ChemAxon polarizability 39.35 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon