1.0 2026-09-22 05:05:36 UTC 2026-09-22 05:05:36 UTC FDB117747 4'-Methoxypropiophenone 1-(4-methoxyphenyl)propan-1-one C10H12O2 164.204 164.083729626 1-(4-methoxyphenyl)propan-1-one 1-(4-methoxyphenyl)propan-1-one CCC(=O)C1=CC=C(OC)C=C1 InChI=1S/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3 ZJVAWPKTWVFKHG-UHFFFAOYSA-N belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. Alkyl-phenylketones Organic compounds Organic oxygen compounds Organooxygen compounds Carbonyl compounds Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Aryl alkyl ketones Benzoyl derivatives Hydrocarbon derivatives Methoxybenzenes Organic oxides Phenoxy compounds Phenylpropanes Alkyl aryl ether Alkyl-phenylketone Anisole Aromatic homomonocyclic compound Aryl alkyl ketone Benzenoid Benzoyl Ether Hydrocarbon derivative Methoxybenzene Monocyclic benzene moiety Organic oxide Phenol ether Phenoxy compound Phenylpropane logp 2.26 ALOGPS logs -2.56 ALOGPS solubility 4.56e-01 g/l ALOGPS logp 2.07 ChemAxon pka_strongest_acidic 16.87 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac 1-(4-methoxyphenyl)propan-1-one ChemAxon average_mass 164.204 ChemAxon mono_mass 164.083729626 ChemAxon smiles CCC(=O)C1=CC=C(OC)C=C1 ChemAxon formula C10H12O2 ChemAxon inchi InChI=1S/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3 ChemAxon inchikey ZJVAWPKTWVFKHG-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 47.55 ChemAxon polarizability 18.22 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1307434 Specdb::MsMs 1307435 Specdb::MsMs 1307436 Specdb::MsMs 1421944 Specdb::MsMs 1421945 Specdb::MsMs 1421946