1.0 2026-09-22 05:06:15 UTC 2026-09-22 05:06:15 UTC FDB117748 Perfluorononanoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoic acid C9HF17O2 464.0759 463.970508761 heptadecafluorononanoic acid perfluorononanoic acid OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) UZUFPBIDKMEQEQ-UHFFFAOYSA-N belongs to the class of organic compounds known as perfluorooctanoic acid and derivatives. These are organic compounds containing an octyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms. Perfluorooctanoic acid and derivatives Organic compounds Organohalogen compounds Alkyl halides Alkyl fluorides Aliphatic acyclic compounds Alpha-halocarboxylic acids Carbonyl compounds Carboxylic acids Halogenated fatty acids Hydrocarbon derivatives Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Organofluorides Aliphatic acyclic compound Alpha-halocarboxylic acid Alpha-halocarboxylic acid or derivatives Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Halogenated fatty acid Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organofluoride Organooxygen compound Perfluorooctanoic acid or derivatives fluoroalkanoic acid logp 4.55 ALOGPS logs -4.33 ALOGPS solubility 2.18e-02 g/l ALOGPS logp 5.81 ChemAxon pka_strongest_acidic -6.5 ChemAxon iupac heptadecafluorononanoic acid ChemAxon average_mass 464.0759 ChemAxon mono_mass 463.970508761 ChemAxon smiles OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ChemAxon formula C9HF17O2 ChemAxon inchi InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) ChemAxon inchikey UZUFPBIDKMEQEQ-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 46.33 ChemAxon polarizability 20.63 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 34370 Specdb::CMs 48745 Specdb::CMs 161776 Specdb::MsMs 47445 Specdb::MsMs 47446 Specdb::MsMs 47447 Specdb::MsMs 146604 Specdb::MsMs 146605 Specdb::MsMs 146606 Specdb::MsMs 435959 Specdb::MsMs 435960 Specdb::MsMs 435961 Specdb::MsMs 435962 Specdb::MsMs 435963 Specdb::MsMs 435964 Specdb::MsMs 435965 Specdb::MsMs 435966 Specdb::MsMs 3035144 Specdb::MsMs 3035145 Specdb::MsMs 3035146 Specdb::MsMs 3104720 Specdb::MsMs 3104721 Specdb::MsMs 3104722