1.0 2026-09-22 05:28:17 UTC 2026-09-22 05:28:17 UTC FDB117770 Perfluoroundecanoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecanoic acid C11HF21O2 564.0909 563.964121581 henicosafluoroundecanoic acid henicosafluoroundecanoic acid OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F InChI=1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) SIDINRCMMRKXGQ-UHFFFAOYSA-N belongs to the class of organic compounds known as perfluoroalkyl carboxylic acid and derivatives. These are organic compounds containing an alkyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the alkyl chain are replaced by fluorine atoms. Perfluoroalkyl carboxylic acid and derivatives Organic compounds Organohalogen compounds Alkyl halides Alkyl fluorides Aliphatic acyclic compounds Alpha-halocarboxylic acids Carbonyl compounds Carboxylic acids Halogenated fatty acids Hydrocarbon derivatives Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Organofluorides Aliphatic acyclic compound Alpha-halocarboxylic acid Alpha-halocarboxylic acid or derivatives Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Halogenated fatty acid Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organofluoride Organooxygen compound Perfluoroalkyl carboxylic acid or derivatives fluoroalkanoic acid logp 5.24 ALOGPS logs -4.34 ALOGPS solubility 2.59e-02 g/l ALOGPS logp 7.21 ChemAxon pka_strongest_acidic -5.2 ChemAxon iupac henicosafluoroundecanoic acid ChemAxon average_mass 564.0909 ChemAxon mono_mass 563.964121581 ChemAxon smiles OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ChemAxon formula C11HF21O2 ChemAxon inchi InChI=1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) ChemAxon inchikey SIDINRCMMRKXGQ-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 55.67 ChemAxon polarizability 25.01 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 36380 Specdb::CMs 48748 Specdb::CMs 282056 Specdb::CMs 350919 Specdb::MsMs 55911 Specdb::MsMs 55912 Specdb::MsMs 55913 Specdb::MsMs 111189 Specdb::MsMs 111190 Specdb::MsMs 111191 Specdb::MsMs 435971 Specdb::MsMs 435972 Specdb::MsMs 2345093 Specdb::MsMs 2345094 Specdb::MsMs 2345095 Specdb::MsMs 2589655 Specdb::MsMs 2589656 Specdb::MsMs 2589657