1.0 2026-09-22 05:31:13 UTC 2026-09-22 05:31:13 UTC FDB117773 4-Methylmorpholine 4-oxide 4-methyl-4-oxido-morpholin-4-ium 4-methyl-4-oxidomorpholin-4-ium C5H11NO2 117.148 117.078978598 4-methylmorpholin-4-ium-4-olate N-methylmorpholine N-oxide C[N+]1([O-])CCOCC1 InChI=1S/C5H11NO2/c1-6(7)2-4-8-5-3-6/h2-5H2,1H3 LFTLOKWAGJYHHR-UHFFFAOYSA-N belongs to the class of organic compounds known as morpholines. These are organic compounds containing a morpholine moiety, which consists of a six-member aliphatic saturated ring with the formula C4H9NO, where the oxygen and nitrogen atoms lie at positions 1 and 4, respectively. Morpholines Organic compounds Organoheterocyclic compounds Oxazinanes Morpholines Aliphatic heteromonocyclic compounds Azacyclic compounds Dialkyl ethers Hydrocarbon derivatives Organic oxides Organopnictogen compounds Oxacyclic compounds Trialkyl amine oxides Trisubstituted amine oxides and derivatives Aliphatic heteromonocyclic compound Azacycle Dialkyl ether Ether Hydrocarbon derivative Morpholine N-oxide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Trialkyl amine oxide Trisubstituted n-oxide morpholine N-oxide logp -1.69 ALOGPS logs -0.29 ALOGPS solubility 5.94e+01 g/l ALOGPS logp -1.2 ChemAxon pka_strongest_basic 3.61 ChemAxon iupac 4-methylmorpholin-4-ium-4-olate ChemAxon average_mass 117.148 ChemAxon mono_mass 117.078978598 ChemAxon smiles C[N+]1([O-])CCOCC1 ChemAxon formula C5H11NO2 ChemAxon inchi InChI=1S/C5H11NO2/c1-6(7)2-4-8-5-3-6/h2-5H2,1H3 ChemAxon inchikey LFTLOKWAGJYHHR-UHFFFAOYSA-N ChemAxon polar_surface_area 32.29 ChemAxon refractivity 31.11 ChemAxon polarizability 12.08 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1255048 Specdb::MsMs 1255049 Specdb::MsMs 1255050 Specdb::MsMs 1370248 Specdb::MsMs 1370249 Specdb::MsMs 1370250