1.0 2026-09-22 08:13:53 UTC 2026-09-22 08:13:53 UTC FDB117948 2,3-Anhydromevalonic acid 4-methyl-2,3-dihydropyran-6-one C6H8O2 112.128 112.052429498 4-methyl-5,6-dihydro-2H-pyran-2-one 4-methyl-5,6-dihydropyran-2-one CC1=CC(=O)OCC1 InChI=1S/C6H8O2/c1-5-2-3-8-6(7)4-5/h4H,2-3H2,1H3 RPEASMBMVIKUTH-UHFFFAOYSA-N belongs to the class of organic compounds known as dihydropyranones. Dihydropyranones are compounds containing a hydrogenated pyran ring which bears a ketone, and contains one double bond. Dihydropyranones Organic compounds Organoheterocyclic compounds Pyrans Pyranones and derivatives Aliphatic heteromonocyclic compounds Carbonyl compounds Enoate esters Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Aliphatic heteromonocyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dihydropyranone Enoate ester Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle logp 0.88 ALOGPS logs -0.48 ALOGPS solubility 3.72e+01 g/l ALOGPS logp 1.07 ChemAxon pka_strongest_acidic 17.48 ChemAxon pka_strongest_basic -6.8 ChemAxon iupac 4-methyl-5,6-dihydro-2H-pyran-2-one ChemAxon average_mass 112.128 ChemAxon mono_mass 112.052429498 ChemAxon smiles CC1=CC(=O)OCC1 ChemAxon formula C6H8O2 ChemAxon inchi InChI=1S/C6H8O2/c1-5-2-3-8-6(7)4-5/h4H,2-3H2,1H3 ChemAxon inchikey RPEASMBMVIKUTH-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 30.28 ChemAxon polarizability 11.4 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon