1.0 2026-09-22 16:24:16 UTC 2026-09-22 16:24:16 UTC FDB118516 N-Methyl-2-methylindole 1,2-dimethylindole C10H11N 145.205 145.089149358 1,2-dimethyl-1H-indole 1,2-dimethylindole CN1C(C)=CC2=CC=CC=C12 InChI=1S/C10H11N/c1-8-7-9-5-3-4-6-10(9)11(8)2/h3-7H,1-2H3 BJMUOUXGBFNLSN-UHFFFAOYSA-N belongs to the class of organic compounds known as n-alkylindoles. N-alkylindoles are compounds containing an indole moiety that carries an alkyl chain at the 1-position. N-alkylindoles Organic compounds Organoheterocyclic compounds Indoles and derivatives N-alkylindoles Aromatic heteropolycyclic compounds Azacyclic compounds Benzenoids Heteroaromatic compounds Hydrocarbon derivatives Indoles N-methylpyrroles Organonitrogen compounds Organopnictogen compounds Aromatic heteropolycyclic compound Azacycle Benzenoid Heteroaromatic compound Hydrocarbon derivative Indole N-alkylindole N-methylpyrrole Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyrrole Substituted pyrrole logp 2.97 ALOGPS logs -2.37 ALOGPS solubility 6.18e-01 g/l ALOGPS logp 2.5 ChemAxon iupac 1,2-dimethyl-1H-indole ChemAxon average_mass 145.205 ChemAxon mono_mass 145.089149358 ChemAxon smiles CN1C(C)=CC2=CC=CC=C12 ChemAxon formula C10H11N ChemAxon inchi InChI=1S/C10H11N/c1-8-7-9-5-3-4-6-10(9)11(8)2/h3-7H,1-2H3 ChemAxon inchikey BJMUOUXGBFNLSN-UHFFFAOYSA-N ChemAxon polar_surface_area 4.93 ChemAxon refractivity 47.19 ChemAxon polarizability 17.13 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon