1.0 2026-09-22 20:23:26 UTC 2026-09-22 20:23:26 UTC FDB118828 2-((4-(dimethylamino)phenyl)diazenyl)benzoic acid 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid 2-[4-(dimethylamino)phenyl]azobenzoic acid C15H15N3O2 269.2985 269.116426739 2-[(E)-2-[4-(dimethylamino)phenyl]diazen-1-yl]benzoic acid methyl red CN(C)C1=CC=C(C=C1)\N=N\C1=CC=CC=C1C(O)=O InChI=1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ CEQFOVLGLXCDCX-WUKNDPDISA-N belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. Azobenzenes Organic compounds Organoheterocyclic compounds Azobenzenes Aromatic homomonocyclic compounds Amino acids Aniline and substituted anilines Azo compounds Benzoic acids Benzoyl derivatives Carboxylic acids Dialkylarylamines Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Amine Amino acid Amino acid or derivatives Aniline or substituted anilines Aromatic homomonocyclic compound Azo compound Azobenzene Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carboxylic acid Carboxylic acid derivative Dialkylarylamine Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound Tertiary aliphatic/aromatic amine Tertiary amine azobenzenes monocarboxylic acid tertiary amino compound logp 3.74 ALOGPS logs -3.49 ALOGPS solubility 8.69e-02 g/l ALOGPS logp 3.31 ChemAxon pka_strongest_acidic 3.15 ChemAxon pka_strongest_basic 3.79 ChemAxon iupac 2-[(E)-2-[4-(dimethylamino)phenyl]diazen-1-yl]benzoic acid ChemAxon average_mass 269.2985 ChemAxon mono_mass 269.116426739 ChemAxon smiles CN(C)C1=CC=C(C=C1)\N=N\C1=CC=CC=C1C(O)=O ChemAxon formula C15H15N3O2 ChemAxon inchi InChI=1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ ChemAxon inchikey CEQFOVLGLXCDCX-WUKNDPDISA-N ChemAxon polar_surface_area 65.26 ChemAxon refractivity 82.06 ChemAxon polarizability 29.14 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 60936 Specdb::MsMs 60937 Specdb::MsMs 60938 Specdb::MsMs 117378 Specdb::MsMs 117379 Specdb::MsMs 117380