1.0 2026-09-22 22:13:37 UTC 2026-09-22 22:13:37 UTC FDB118958 2-Ethyl-m-xylene 2-ethyl-1,3-dimethyl-benzene 2-ethyl-1,3-dimethylbenzene C10H14 134.222 134.109550451 2-ethyl-1,3-dimethylbenzene 1,3-dimethyl-2-ethylbenzene CCC1=C(C)C=CC=C1C InChI=1S/C10H14/c1-4-10-8(2)6-5-7-9(10)3/h5-7H,4H2,1-3H3 CHIKRULMSSADAF-UHFFFAOYSA-N belongs to the class of organic compounds known as m-xylenes. These are aromatic compounds that contain a m-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 3-positions. m-Xylenes Organic compounds Benzenoids Benzene and substituted derivatives Xylenes Aromatic homomonocyclic compounds Aromatic hydrocarbons Unsaturated hydrocarbons Aromatic homomonocyclic compound Aromatic hydrocarbon Hydrocarbon M-xylene Unsaturated hydrocarbon logp 4.40 ALOGPS logs -3.84 ALOGPS solubility 1.95e-02 g/l ALOGPS logp 3.96 ChemAxon iupac 2-ethyl-1,3-dimethylbenzene ChemAxon average_mass 134.222 ChemAxon mono_mass 134.109550451 ChemAxon smiles CCC1=C(C)C=CC=C1C ChemAxon formula C10H14 ChemAxon inchi InChI=1S/C10H14/c1-4-10-8(2)6-5-7-9(10)3/h5-7H,4H2,1-3H3 ChemAxon inchikey CHIKRULMSSADAF-UHFFFAOYSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 45.78 ChemAxon polarizability 16.82 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon