1.0 2026-09-22 23:49:45 UTC 2026-09-22 23:49:45 UTC FDB119124 Perfluoroheptanoic acid 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid C7HF13O2 364.062 363.976895391 tridecafluoroheptanoic acid perfluoroheptanoic acid OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F InChI=1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) ZWBAMYVPMDSJGQ-UHFFFAOYSA-N belongs to the class of organic compounds known as perfluoroalkyl carboxylic acid and derivatives. These are organic compounds containing an alkyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the alkyl chain are replaced by fluorine atoms. Perfluoroalkyl carboxylic acid and derivatives Organic compounds Organohalogen compounds Alkyl halides Alkyl fluorides Aliphatic acyclic compounds Alpha-halocarboxylic acids Carbonyl compounds Carboxylic acids Halogenated fatty acids Hydrocarbon derivatives Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Organofluorides Aliphatic acyclic compound Alpha-halocarboxylic acid Alpha-halocarboxylic acid or derivatives Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Halogenated fatty acid Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organofluoride Organooxygen compound Perfluoroalkyl carboxylic acid or derivatives fluoroalkanoic acid logp 3.93 ALOGPS logs -4.28 ALOGPS solubility 1.90e-02 g/l ALOGPS logp 4.41 ChemAxon pka_strongest_acidic -2.3 ChemAxon iupac tridecafluoroheptanoic acid ChemAxon average_mass 364.062 ChemAxon mono_mass 363.976895391 ChemAxon smiles OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ChemAxon formula C7HF13O2 ChemAxon inchi InChI=1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) ChemAxon inchikey ZWBAMYVPMDSJGQ-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 36.99 ChemAxon polarizability 16.32 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 106325 Specdb::CMs 118508 Specdb::CMs 955056 Specdb::CMs 955057 Specdb::MsMs 108498 Specdb::MsMs 108499 Specdb::MsMs 108500 Specdb::MsMs 175737 Specdb::MsMs 175738 Specdb::MsMs 175739 Specdb::MsMs 2228767 Specdb::MsMs 2230657 Specdb::MsMs 2233036 Specdb::MsMs 2244197 Specdb::MsMs 2245880 Specdb::MsMs 2246383 Specdb::MsMs 2247919 Specdb::MsMs 2248334 Specdb::MsMs 2250342 Specdb::MsMs 2252063 Specdb::MsMs 2256529 Specdb::MsMs 2258047 Specdb::MsMs 2258506 Specdb::MsMs 2260088