1.0 2026-09-23 00:25:47 UTC 2026-09-23 00:25:47 UTC FDB119178 Perfluorodecanoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid C10HF19O2 514.0834 513.967315171 nonadecafluorodecanoic acid perfluorodecanoic acid OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F InChI=1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) PCIUEQPBYFRTEM-UHFFFAOYSA-N belongs to the class of organic compounds known as perfluoroalkyl carboxylic acid and derivatives. These are organic compounds containing an alkyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the alkyl chain are replaced by fluorine atoms. Perfluoroalkyl carboxylic acid and derivatives Organic compounds Organohalogen compounds Alkyl halides Alkyl fluorides Aliphatic acyclic compounds Alpha-halocarboxylic acids Carbonyl compounds Carboxylic acids Halogenated fatty acids Hydrocarbon derivatives Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Organofluorides Aliphatic acyclic compound Alpha-halocarboxylic acid Alpha-halocarboxylic acid or derivatives Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Halogenated fatty acid Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organofluoride Organooxygen compound Perfluoroalkyl carboxylic acid or derivatives fluoroalkanoic acid logp 4.85 ALOGPS logs -4.34 ALOGPS solubility 2.37e-02 g/l ALOGPS logp 6.51 ChemAxon pka_strongest_acidic -5.2 ChemAxon iupac nonadecafluorodecanoic acid ChemAxon average_mass 514.0834 ChemAxon mono_mass 513.967315171 ChemAxon smiles OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ChemAxon formula C10HF19O2 ChemAxon inchi InChI=1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) ChemAxon inchikey PCIUEQPBYFRTEM-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 51 ChemAxon polarizability 22.75 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 742 Specdb::MsMs 47976 Specdb::MsMs 47977 Specdb::MsMs 47978 Specdb::MsMs 132780 Specdb::MsMs 132781 Specdb::MsMs 132782 Specdb::MsMs 435967 Specdb::MsMs 435968 Specdb::MsMs 435969 Specdb::MsMs 435970 Specdb::MsMs 440646 Specdb::MsMs 2391673 Specdb::MsMs 2391674 Specdb::MsMs 2391675 Specdb::MsMs 2570852 Specdb::MsMs 2570853 Specdb::MsMs 2570854 Specdb::CMs 35316 Specdb::CMs 48744